| Name | 2,2'-Biquinoline |
| Synonyms | 2,2'-Biquinoline 2,3''-BIQUINOLINE GR Cuproine 2,2'-Diquinolyl 2,2'-BIQUINOLINE GR (2,2' Diquinolyl) |
| CAS | 119-91-5 |
| EINECS | 204-357-5 |
| InChI | InChI=1/C18H12N2/c1-4-8-17-13(5-1)9-10-18(20-17)15-11-14-6-2-3-7-16(14)19-12-15/h1-12H |
| InChIKey | WPTCSQBWLUUYDV-UHFFFAOYSA-N |
| Molecular Formula | C18H12N2 |
| Molar Mass | 256.3 |
| Density | 1.223g/cm3 |
| Melting Point | 193-196℃ |
| Boling Point | 450.1°C at 760 mmHg |
| Flash Point | 200.2°C |
| Water Solubility | Sparingly soluble in water (0.001g/L). |
| Solubility | Soluble in ethanol, ether, acetone, benzene and chloroform, insoluble in water, |
| Vapor Presure | 7.21E-08mmHg at 25°C |
| Appearance | Shape Shiny Flakes, color Slightly yellow to light beige |
| pKa | 2.19±0.61(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.72 |
| MDL | MFCD00006740 |
| Physical and Chemical Properties | Melting point 193-196°C. |
| Use | Use copper reagent. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 8 |
| TSCA | Yes |
| HS Code | 29334990 |
| solubility | 1.02mg/l |
| BRN | 187259 |
| NIST chemical information | 2,2'-Biquinoline(119-91-5) |
| EPA chemical information | 2,2'-Biquinoline (119-91-5) |