| Name | 3',4',5,5',7-Pentamethoxyflavone |
| Synonyms | PROTOPANAXADIOL(P) TRICIN 5,7,4'-TRIMETHYL ETHER 3',4',5,5',7-PENTAMETHOXYFLAVONE 3',4',5',5,7-PENTAMETHOXYFLAVONE 3',4',5',5,7-Pentamethoxyflavone 3',4',5,5',7-Pentamethoxyflavone 5,7,3',4',5'-PENTAMETHOXYFLAVONE PENTAMETHOXYFLAVONE, 3',4',5',5,7- PENTAMETHOXYFLAVONE, 3',4',5',5,7-(RG) 5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one |
| CAS | 53350-26-8 |
| InChI | InChI=1/C20H20O7/c1-22-12-8-15(23-2)19-13(21)10-14(27-16(19)9-12)11-6-17(24-3)20(26-5)18(7-11)25-4/h6-10H,1-5H3 |
| Molecular Formula | C20H20O7 |
| Molar Mass | 372.37 |
| Density | 1.244±0.06 g/cm3(Predicted) |
| Melting Point | 198-200°C |
| Boling Point | 554.4±50.0 °C(Predicted) |
| Flash Point | 243.5°C |
| Solubility | Hot Acetone, Warm Ethanol, Methanol |
| Vapor Presure | 2.48E-12mmHg at 25°C |
| Appearance | off-white crystalline solid |
| Color | Off-White Crystalline |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.565 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| biological activity | 3 ',4',5 ',5,7-Pentamethoxyflavone is a natural brass compound extracted from Rutaceae, which overcomes the drug resistance caused by chemotherapeutic drugs to cancer cells by inhibiting Nrf2 pathway. |