| Name | 4,4'-Difluorobenzophenone |
| Synonyms | Di-p-fluorophenyl ketone 4,4-DIFLUOROBENZOPHENONE 4,4'-difluoro-benzophenon bis(p-fluorophenyl)ketone 4,4'-Difluorobenzophenone 4,4'-DIFLUOROBENZOPHENONE Bis(p-fluorophenyl) ketone bis(4-fluorophenyl)-methanon Benzophenone, 4,4'-difluoro- |
| CAS | 345-92-6 |
| EINECS | 206-466-3 |
| InChI | InChI:1S/C13H8F2O/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H |
| Molecular Formula | C13H8F2O |
| Molar Mass | 218.2 |
| Density | 1.214g/cm3 |
| Melting Point | 106-109℃ |
| Boling Point | 276.909°C at 760 mmHg |
| Flash Point | 105.937°C |
| Vapor Presure | 0.005mmHg at 25°C |
| Appearance | White crystal |
| Storage Condition | Room Temprature |
| Refractive Index | 1.544 |
| MDL | MFCD00000353 |
| Physical and Chemical Properties | Melting Point: 109.0 ℃ |
| Use | It can be used as an imaging agent and charge control agent for optical recording and electrical recording materials, and can also be used as an initiator for some polymerization reactions. It is a monomer material for many copolymers. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| RTECS number | DJ0685000 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| customs code | 29143990 |
| storage conditions | Sealed in dry,Room Temperature |
| morphology | Crystalline Powder |
| color | White to slightly yellow |
| BRN | 516231 |
| InChIKey | LSQARZALBDFYQZ-UHFFFAOYSA-N |
| NIST chemical information | 4,4'-Difluorobenzophenone(345-92-6) |
| EPA chemical information | 4,4'-Difluorobenzophenone (345-92-6) |