| Name | 4,4'-dimethyl-2,2'-dipyridyl |
| Synonyms | Bipicoline DiMethyl-2,2-dip 2,2-Bi-4-picoline 2,2-Bi-(4-picolyl) 2,2'-BI-4-PICOLINE 4,4-dimethyl-2,2-bipyridyl 4,4-Dimethyl-2,2-bipyridine 4,4'-dimethyl-2,2'-dipyridyl 4,4'-Dimethyl-2,2'-bipyridyl 4,4'-dimethyl-2,2'-bipyridine 2'-Bipyridine,4,4'-dimethyl-2 2,2'-Bipyridyl, 4,4'-dimethyl- 2,2'-Bipyridine, 4,4'-diMethyl- 2'-Bipyridine, 4,4'-diMethyl-2,2'-Bi-4-picoline (6CI,7CI,8CI) |
| CAS | 1134-35-6 |
| EINECS | 214-483-2 |
| InChI | InChI=1/C12H12N2/c1-9-3-5-13-11(7-9)12-8-10(2)4-6-14-12/h3-8H,1-2H3 |
| InChIKey | NBPGPQJFYXNFKN-UHFFFAOYSA-N |
| Molecular Formula | C12H12N2 |
| Molar Mass | 184.24 |
| Density | 1.1160 (rough estimate) |
| Melting Point | 169-174°C(lit.) |
| Boling Point | 308.2°C (rough estimate) |
| Flash Point | 116.8°C |
| Water Solubility | Soluble in ethanol, acetic acid, benzene, toluene. Highly soluble in water at pH < 2. |
| Vapor Presure | 0.00118mmHg at 25°C |
| Appearance | Crystalline Powder |
| Color | Beige |
| BRN | 128995 |
| pKa | 5.10±0.30(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.6266 (estimate) |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| RTECS | DW1765000 |
| TSCA | Yes |
| HS Code | 29339900 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | 4,4 '-dimethyl-2, 2'-bipyridine is a useful research chemical. 4,4'-dimethyl -2,2 '-bipyridine is used as a bidentate ligand and metal complexation for detection, for organic synthesis reactions, etc. the starting substance for synthesizing blue luminescent molecules is excited in a 43% quantum field and 450 nm. |