| Product Name | 2-Acetyl-5-methylfuran |
| Synonyms | 2-Acetyl, 5-mefuran 2-Acetyl-5-methylfuran 2-acetyl-5-methyl-fura 5-Methyl-2-acetalfuran 5-methyl-2-acetylfuran 2-ACETYL-5-METHYLFURANE 5-Methyl-2-Acetyl Furan |
| CAS | 1193-79-9 |
| EINECS | 214-779-1 |
| Chemical Formula | C7H8O2 |
| Molecular Weight | 124.14 |
| inchi | InChI=1/C7H8O2/c1-5-3-4-7(9-5)6(2)8/h3-4H,1-2H3 |
| Package | 25KG/Drum |
| Price | RFQ |
| Descriptions | The English name of 5-methyl-2-acetylfuran is Ethanone, 1- (5-methyl-2-furanyl) -, the Chinese alias is 2-acetyl-5-methylfuran, the CAS number is 1193-79-9, the molecular formula is C7H8O2, and the molecular weight is 124.14. It is a high-purity organic reagent and can be used as a daily essence. |
| Supplier Website | |
| Last Update | 2026-02-09 10:32:56 |