![]() | |
| Supplier Name | |
| Tel | 010-50973130 |
| Mobile | 18101056239(微信同号) |
| 3193328036@qq.com | |
| Website | http://solarbio.com |
| 18101056239 | |
| Product Name | Octoxinol |
| Synonyms | Octoxinol Emulsifier Triton x-100 Emulsifier TX-10 Emulsifier op-10 Polyethylene glycol octylphenyl ether 26-(4-octylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol |
| CAS | 9002-93-1 |
| EINECS | 255-695-5 |
| Chemical Formula | (C2H4O)N·C14H22O |
| Molecular Weight | 602.797 |
| inchi | InChI=1/C32H58O10/c1-2-3-4-5-6-7-10-31-11-8-9-12-32(31)42-30-29-41-28-27-40-26-25-39-24-23-38-22-21-37-20-19-36-18-17-35-16-15-34-14-13-33/h8-9,11-12,33H,2-7,10,13-30H2,1H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2026-02-10 11:15:19 |