![]() | |
| Supplier Name | Nantong Reform Petro-Chemical CO., LTD. |
| Contact | Miss cai |
| Tel | +86-13776910623 |
| Mobile | +86-13776910623 |
| r@reformchem.com | |
| Website | https://www.reformchem.com |
| chemical6666 | |
| Product Name | 2-Deoxy-2,2-difluoro-D-erythro pentonic acid gamma-lactone 3,5-dibenzoate |
| Synonyms | GEMCITABINE INTERMEDIATE capecitabine intermediate Intermediate of Capecitabine 2-deoxy-2,2-difluoro-γ-lactone, 3,5-dibenzoate- 2'-Deoxy-2',2'-difluoro-D-erythro-pentofuranous- 2-Deoxy-2,2-difluoropentofuranos-1-ulose-3,5-dibenzoate |
| CAS | 122111-01-7 |
| EINECS | 601-822-8 |
| Chemical Formula | C19H14F2O6 |
| Molecular Weight | 376.31 |
| inchi | InChI=1/C19H14F2O6/c20-19(21)15(27-17(23)13-9-5-2-6-10-13)14(26-18(19)24)11-25-16(22)12-7-3-1-4-8-12/h1-10,14-15H,11H2 |
| Package | 1kg, 25kg, 200kg |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2026-02-10 10:28:05 |