(2,5-dimethylphenyl)acetyl chloride - Names and Identifiers
Name | (2,5-dimethylphenyl)acetyl chloride
|
Synonyms | 2,5-Dimethylphenylacetyl chloride (2,5-dimethylphenyl)acetyl chloride (2,5-Dimethylphenyl)acetyl chloride 2,5-Dimethyl phenyl acetic chloride Benzeneacetyl chloride, 2,5-dimethyl- 2-(2,5-Dimethylphenyl)acetyl Chloride benzeneacetyl chloride, 2,5-dimethyl-
|
CAS | 55312-97-5
|
InChI | InChI=1/C10H11ClO/c1-7-3-4-8(2)9(5-7)6-10(11)12/h3-5H,6H2,1-2H3 |
(2,5-dimethylphenyl)acetyl chloride - Physico-chemical Properties
Molecular Formula | C10H11ClO
|
Molar Mass | 182.65 |
Density | 1.11 |
Boling Point | 260.3±19.0 °C(Predicted) |
Flash Point | 113.995°C |
Vapor Presure | 0.012mmHg at 25°C |
Appearance | clear liquid |
Color | Colorless to Yellow |
Storage Condition | Room Temprature |
Refractive Index | 1.5290 to 1.5330 |
(2,5-dimethylphenyl)acetyl chloride - Risk and Safety
UN IDs | UN 3265 8/PG II |
Hazard Class | 8 |
Packing Group | II |
(2,5-dimethylphenyl)acetyl chloride - Introduction
(2,5-dimethylphenyl)acetyl chloride is an organic compound with the chemical formula C10H11ClO. The following is a description of its nature, use, preparation and safety information:
Nature:
-Appearance: Colorless or light yellow liquid.
-Solubility: Soluble in organic solvents, such as ether, chloroform and dichloromethane, insoluble in water.
-Melting point:-7°C.
-Boiling point: 235-237°C.
-Density: Approximately 1.06 g/mL.
-Vapor pressure: 2 mmHg(20°C).
Use:
- (2,5-dimethylphenyl)acetyl chloride is an important organic synthesis intermediate. It can be used to synthesize various organic compounds, such as drugs, pesticides and dyes.
-In the pharmaceutical field, it can be used to synthesize analgesics, anti-inflammatory drugs and anti-cancer drugs, etc.
Preparation Method:
- (2,5-dimethylphenylphenyl) acetyl chloride can be prepared by reacting 2,5-dimethylphenylacetic acid (2,5-dimethylphenylacetic acid) with thionyl chloride (sulfonyl chloride).
-The specific preparation method is that, under appropriate reaction conditions, 2,5-dimethylphenylacetic acid is reacted with thionyl chloride to generate (2,5-dimethylphenylphenyl) acetyl chloride.
Safety Information:
- (2,5-dimethylphenyl)acetyl chloride is corrosive to a certain extent, and contact with skin and eyes can cause irritation and burns. Therefore, personal protective equipment such as protective gloves, goggles and protective clothing should be worn when handling and handling the compound.
-It should be stored in a cool, dry, well-ventilated place, and away from fire and oxidizing agents.
-Avoid inhaling its vapor during use and storage, because it has a certain degree of volatility.
-If you take or breathe by mistake, seek medical attention immediately and provide relevant danger information.
Last Update:2024-04-09 20:48:19