((2R,3R,4R,5R)-3-(benzoyloxy)-5-(2,4-dioxo-3,4-dihydropyriMidin-1(2H)-yl)-4-fluoro-4-Methyltetrahydrofuran-2-yl)Methyl benzoate - Names and Identifiers
Name | 3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-2'-methyluridine
|
Synonyms | Sofosbuvir Intermediate 3 3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-2'-methyluridine 3',5'-di-O-benzoyl-2'-deoxy-2'-fluoro-2'-C-Methyluridine (2'R)-2'-Deoxy-2'-fluoro-2'-Methyl-uridine 3',5'-dibenzoate URIDINE, 2'-DEOXY-2'-FLUORO-2'-METHYL-, 3',5'-DIBENZOATE, (2'R)- 2'Deoxy-2'fluoro-2'- Methyl- 3'5'-bis-o- (phenylcarbonyl) uridine [(2R,3R,4R,5R)-3-Benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyl-tetrahydrofuran-2-yl]methyl benzoate ((2R,3R,4R,5R)-3-(benzoyloxy)-5-(2,4-dioxo-3,4-dihydropyriMidin-1(2H)-yl)-4-fluoro-4-Methyltetrahydrofuran-2-yl)Methyl benzoate
|
CAS | 863329-65-1
|
InChI | InChI=1S/C24H21FN2O7/c1-24(25)19(34-21(30)16-10-6-3-7-11-16)17(14-32-20(29)15-8-4-2-5-9-15)33-22(24)27-13-12-18(28)26-23(27)31/h2-13,17,19,22H,14H2,1H3,(H,26,28,31)/t17-,19-,22-,24-/m1/s1 |
((2R,3R,4R,5R)-3-(benzoyloxy)-5-(2,4-dioxo-3,4-dihydropyriMidin-1(2H)-yl)-4-fluoro-4-Methyltetrahydrofuran-2-yl)Methyl benzoate - Physico-chemical Properties
Molecular Formula | C24H21FN2O7
|
Molar Mass | 468.43 |
Density | 1.42 |
Melting Point | 256-258℃ |
Water Solubility | 3.7mg/L |
Storage Condition | 2-8℃ |
((2R,3R,4R,5R)-3-(benzoyloxy)-5-(2,4-dioxo-3,4-dihydropyriMidin-1(2H)-yl)-4-fluoro-4-Methyltetrahydrofuran-2-yl)Methyl benzoate - Introduction
3 ',5'-Di-O-benzoyl-2 '-deoxy-2'-fluoro-2 '-methyluridine is an organic compound with the following properties:
1. Appearance: Colorless to light yellow crystalline solid.
2. solubility: can be dissolved in some organic solvents, such as chloroform, dimethylformamide and ethyl acetate.
3. melting point: about 65-70 degrees Celsius.
4. Stability: relatively stable under dry conditions.
3 ',5'-Di-O-benzoyl-2 '-deoxy-2'-fluoro-2 '-The scope of use of methyluridine mainly includes the following aspects:
1. chemical synthesis: it can be used as the starting material or intermediate in organic synthesis, and participate in the synthesis reaction of nucleic acid.
2. Drug research: It can be applied to the field of drug research and development, especially in the field of nucleic acid drugs.
3. Biochemistry research: It can be used in nucleic acid biochemistry research, such as RNA modification, nucleotide metabolism, etc.
Methods for preparing 3 ',5'-Di-O-benzoyl-2 '-deoxy-2'-fluoro-2 '-methyluridine are generally accomplished by chemical synthesis. This synthesis involves a multi-step reaction that requires the first synthesis of (2'R)-2 '-deoxy-2'-fluoro-2 '-methyluridine, followed by reaction with 3',5 '-dibenzoyl chloride to obtain the desired product.
When using and handling this compound, you need to pay attention to the following safety information:
1. the skin and eyes are irritating, please avoid contact, such as accidental contact, please rinse immediately with plenty of water.
2. inhalation or ingestion may cause health hazards, should avoid inhalation of dust or eating, avoid contact with food and drinking water.
3. During the operation, good laboratory practice should be followed and appropriate personal protective equipment should be worn, such as laboratory gloves and protective glasses.
4. Please store the compound in a dry, cool, well-ventilated place, away from fire and oxidizing agents.
Last Update:2024-04-10 22:40:09