(2-Amino-2-phenylethyl)carbamic acid benzyl ester
benzyl (2-amino-2-phenylethyl)carbamate
CAS: 84477-93-0
Molecular Formula: C16H18N2O2
(2-Amino-2-phenylethyl)carbamic acid benzyl ester - Names and Identifiers
| Name | benzyl (2-amino-2-phenylethyl)carbamate |
| Synonyms | N-Cbz-2-amino-2-phenylethylamine benzyl (2-amino-2-phenylethyl)carbamate benzyl N-(2-amino-2-phenylethyl)carbamate (2-Amino-2-phenylethyl)carbamic acid benzyl ester (2-AMINO-2-PHENYL-ETHYL)-CARBAMIC ACID BENZYL ESTER Carbamic acid, (2-amino-2-phenylethyl)-, phenylmethyl ester (9CI) |
| CAS | 84477-93-0 |
| InChI | InChI=1/C16H18N2O2/c17-15(14-9-5-2-6-10-14)11-18-16(19)20-12-13-7-3-1-4-8-13/h1-10,15H,11-12,17H2,(H,18,19) |
(2-Amino-2-phenylethyl)carbamic acid benzyl ester - Physico-chemical Properties
| Molecular Formula | C16H18N2O2 |
| Molar Mass | 270.33 |
| Density | 1.161±0.06 g/cm3(Predicted) |
| Boling Point | 460.8±45.0 °C(Predicted) |
| Flash Point | 232.5°C |
| Vapor Presure | 1.13E-08mmHg at 25°C |
| pKa | 12.08±0.46(Predicted) |
| Refractive Index | 1.589 |
(2-Amino-2-phenylethyl)carbamic acid benzyl ester - Introduction
Benzyl (2-amino-2-phenylethyl)carbamate is an organic compound containing benzyl and (2-amino-2-phenylethyl) groups in its chemical structure. The main properties are as follows:
1. Appearance: benzyl (2-amino-2-phenylethyl) is carbamate as colorless or slightly yellow crystal or powder.
2. solubility: soluble in alcohol solvent, insoluble in water.
carbamate main uses of benzyl (2-amino-2-phenylethyl) are as follows:
1. pharmaceutical field: as an important intermediate in the synthesis of medicine, such as a precursor for the synthesis of drugs.
2. chemical research: used as an important organic synthesis reagent, involved in the synthesis of aniline and methylamine and other compounds.
The preparation of benzyl (2-amino-2-phenylethyl)carbamate is usually carried out by the following steps:
1. reaction one: benzyl aminoethanol reacts with benzyl carbamate to generate benzyl carbamate.
2. Reaction 2: Benzyl carbamate benzyl ester is reacted with phenylacetaldehyde to generate benzyl (2-amino-2-phenylethyl)carbamate.
When preparing and operating, pay attention to the following safety information:
1. use should wear protective gloves and protective glasses, avoid direct contact with skin and eyes.
2. Operate in a well-ventilated place to avoid inhaling its dust.
3. Avoid contact with strong oxidants and strong acids to avoid dangerous reactions.
4. Store in a dry, cool place, away from fire and combustibles.
1. Appearance: benzyl (2-amino-2-phenylethyl) is carbamate as colorless or slightly yellow crystal or powder.
2. solubility: soluble in alcohol solvent, insoluble in water.
carbamate main uses of benzyl (2-amino-2-phenylethyl) are as follows:
1. pharmaceutical field: as an important intermediate in the synthesis of medicine, such as a precursor for the synthesis of drugs.
2. chemical research: used as an important organic synthesis reagent, involved in the synthesis of aniline and methylamine and other compounds.
The preparation of benzyl (2-amino-2-phenylethyl)carbamate is usually carried out by the following steps:
1. reaction one: benzyl aminoethanol reacts with benzyl carbamate to generate benzyl carbamate.
2. Reaction 2: Benzyl carbamate benzyl ester is reacted with phenylacetaldehyde to generate benzyl (2-amino-2-phenylethyl)carbamate.
When preparing and operating, pay attention to the following safety information:
1. use should wear protective gloves and protective glasses, avoid direct contact with skin and eyes.
2. Operate in a well-ventilated place to avoid inhaling its dust.
3. Avoid contact with strong oxidants and strong acids to avoid dangerous reactions.
4. Store in a dry, cool place, away from fire and combustibles.
Last Update：2024-04-09 18:58:34
