Name | (4R-cis)-5-methyl-2-oxoimidazolidine-4-hexanoic acid |
Synonyms | Dethiobiotin DESTHIOBIOTIN D-DESTHIOBIOTIN DL-DESTHIOBIOTIN 5-METHYL-2-OXO-4-IMIDAZOLINE-CAPROIC ACID 6-(5-methyl-2-oxo-imidazolidin-4-yl)hexanoic acid (4R-cis)-5-methyl-2-oxoimidazolidine-4-hexanoic acid |
CAS | 533-48-2 |
EINECS | 208-566-2 |
InChI | InChI=1/C10H18N2O3/c1-7-8(12-10(15)11-7)5-3-2-4-6-9(13)14/h7-8H,2-6H2,1H3,(H,13,14)(H2,11,12,15)/t7-,8+/m0/s1 |
InChIKey | AUTOLBMXDDTRRT-UHFFFAOYSA-N |
Molecular Formula | C10H18N2O3 |
Molar Mass | 214.26 |
Density | 1.1404 (rough estimate) |
Melting Point | 156-158° |
Boling Point | 354.4°C (rough estimate) |
Specific Rotation(α) | D21 +10.7° (c = 2) |
Flash Point | 241.9°C |
Solubility | Aqueous Base (Slightly), DMSO (Slightly) |
Vapor Presure | 2.18E-10mmHg at 25°C |
Appearance | Solid |
Color | White to Off-White |
pKa | 4.77±0.10(Predicted) |
Storage Condition | 2-8°C |
Refractive Index | 1.4550 (estimate) |
WGK Germany | 3 |
biological activity | D-Desthiobiotin is a biotin derivative used for affinity chromatography and protein chromatography, and can also be used for labeling, detection and separation of proteins and cells. |