(R)-(-)-N-benzyl 3-aminopyrrolidine
(R)-(-)-N-benzyl 3-aminopyrrolidine
CAS: 114715-39-8
Molecular Formula: C11H16N2
(R)-(-)-N-benzyl 3-aminopyrrolidine - Names and Identifiers
| Name | (R)-(-)-N-benzyl 3-aminopyrrolidine |
| Synonyms | 1-benzylpyrrolidin-3-amine (R)-N-Benzy-3-aminopyrrolidine (R)-1-Benzy-3-aminopyrrolidine (R)-1-benzyl-3-aminopyrrolidine (3R)-1-Benzylpyrrolidine-3-amine 3-(R)-1-benzyl-3-aminopyrrolidine (R)-(-)-3-Amino-1-benzylpyrrolidine (R)-(-)-N-benzyl 3-aminopyrrolidine (R)-(-)-1-Benzyl-3-aminopyrrolidine [3R,(-)]-1-Benzoyl-3-aminopyrrolidine (3R)-(-)-1-benzyl-pyrrolidin-3-ylaMine (3R)-1-(Phenylmethyl)pyrrolidin-3-amine (3R)-1-benzylpyrrolidin-3-amine hydrochloride |
| CAS | 114715-39-8 |
| EINECS | 623-345-4 |
| InChI | InChI=1/C11H16N2.ClH/c12-11-6-7-13(9-11)8-10-4-2-1-3-5-10;/h1-5,11H,6-9,12H2;1H/t11-;/m1./s1 |
| InChIKey | HBVNLKQGRZPGRP-LLVKDONJSA-N |
(R)-(-)-N-benzyl 3-aminopyrrolidine - Physico-chemical Properties
| Molecular Formula | C11H16N2 |
| Molar Mass | 176.26 |
| Density | 1.064g/mLat 25°C(lit.) |
| Boling Point | 278-279°C(lit.) |
| Specific Rotation(α) | -1.99 º (neat) |
| Flash Point | >230°F |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 0.000994mmHg at 25°C |
| Appearance | Liquid |
| Color | Clear colorless to yellow |
| BRN | 6477592 |
| pKa | 9.74±0.20(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Sensitive | Air Sensitive |
| Refractive Index | n20/D 1.5450(lit.) |
| Physical and Chemical Properties | Density 1.064 Boiling point 278-279°C Refractive index 1.5450 Flash point >110°C alpha -1.99° (neat) |
(R)-(-)-N-benzyl 3-aminopyrrolidine - Risk and Safety
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | UN2735 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Hazard Class | 8 |
| Packing Group | III |
