(S)-Benzyl (2-oxotetrahydrofuran-3-yl)carbaMate
N-Z-L-homoserine lactone
CAS: 35677-89-5
Molecular Formula: C12H13NO4
(S)-Benzyl (2-oxotetrahydrofuran-3-yl)carbaMate - Names and Identifiers
| Name | N-Z-L-homoserine lactone |
| Synonyms | Z-HoMoser lactone Z-L-hoMoserineactone N-Z-L-homoserine lactone Cbz-L-HoMoserine laCLone Cbz-L-Homoserine lactone N-Cbz-L-homoserine lactone N-Carbobenzoxy-L-hoMoserine Lactone (S)-Benzyl (2-oxotetrahydrofuran-3-yl)carbaMate benzyl [(3S)-2-oxotetrahydrofuran-3-yl]carbamate N-((3R)-2-Oxo(3-3,4,5-trihydrofuryl))(phenylmethoxy)carboxamide Carbamic acid, [(3S)-tetrahydro-2-oxo-3-furanyl]-, phenylmethyl ester (9CI) |
| CAS | 35677-89-5 |
| InChI | InChI=1/C12H13NO4/c14-11-10(6-7-16-11)13-12(15)17-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,13,15)/t10-/m0/s1 |
(S)-Benzyl (2-oxotetrahydrofuran-3-yl)carbaMate - Physico-chemical Properties
| Molecular Formula | C12H13NO4 |
| Molar Mass | 235.24 |
| Density | 1.27±0.1 g/cm3(Predicted) |
| Melting Point | 127-132°C |
| Boling Point | 466.1±44.0 °C(Predicted) |
| Flash Point | 235.7°C |
| Vapor Presure | 7.29E-09mmHg at 25°C |
| Appearance | White solid |
| Color | White to Almost white |
| BRN | 5341012 |
| pKa | 11.00±0.20(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.56 |
| MDL | MFCD00674555 |
(S)-Benzyl (2-oxotetrahydrofuran-3-yl)carbaMate - Risk and Safety
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10 |
(S)-Benzyl (2-oxotetrahydrofuran-3-yl)carbaMate - Introduction
N-Z-L-homoserine lactone(N-Z-L-homoserine lactone) is an organic synthetic compound with the following properties:
1. Appearance: White crystalline solid.
2. molecular formula: C17H17NO5.
3. Molecular weight: 319.32g/mol.
4. Melting point: about 170-173°C.
N-Z-L-homoserine lactone have important uses in biological research:
1. Chemical synthesis: It can be used as an intermediate for the synthesis of other organic compounds, such as the synthesis of nitrogen heterocyclic compounds.
2. Biological activity research: The compound is widely used in molecular biology and drug research to study the regulation mechanism of related metabolic pathways in organisms, protein structure and function.
The preparation of N-Z-L-homoserine lactone generally uses organic synthesis methods. The following is a common preparation method:
1. First, L-homoserine is reacted with benzyl chloride (CbzCl) under alkaline conditions to produce N-tert-butoxycarbonyl-L-homoserine (N-Boc-L-homoserine).
2. Next, a heating acid hydrolysis reaction is carried out to remove the tert-butoxycarbonyl protecting group to generate N-H-L-homoserine.
3. Finally, N-H-L-homoserine is reacted with anhydrous acetic acid and dehydrated to obtain N-Z-L-homoserine lactone.
due to the organic synthesis and processing of chemical reagents and other operations, the preparation process should pay attention to safety measures, such as wearing appropriate protective equipment, operating in the fume hood and so on. In addition, specific security information needs to be evaluated according to specific usage scenarios and applications.
1. Appearance: White crystalline solid.
2. molecular formula: C17H17NO5.
3. Molecular weight: 319.32g/mol.
4. Melting point: about 170-173°C.
N-Z-L-homoserine lactone have important uses in biological research:
1. Chemical synthesis: It can be used as an intermediate for the synthesis of other organic compounds, such as the synthesis of nitrogen heterocyclic compounds.
2. Biological activity research: The compound is widely used in molecular biology and drug research to study the regulation mechanism of related metabolic pathways in organisms, protein structure and function.
The preparation of N-Z-L-homoserine lactone generally uses organic synthesis methods. The following is a common preparation method:
1. First, L-homoserine is reacted with benzyl chloride (CbzCl) under alkaline conditions to produce N-tert-butoxycarbonyl-L-homoserine (N-Boc-L-homoserine).
2. Next, a heating acid hydrolysis reaction is carried out to remove the tert-butoxycarbonyl protecting group to generate N-H-L-homoserine.
3. Finally, N-H-L-homoserine is reacted with anhydrous acetic acid and dehydrated to obtain N-Z-L-homoserine lactone.
due to the organic synthesis and processing of chemical reagents and other operations, the preparation process should pay attention to safety measures, such as wearing appropriate protective equipment, operating in the fume hood and so on. In addition, specific security information needs to be evaluated according to specific usage scenarios and applications.
Last Update：2024-04-09 21:04:16
Supplier List
Spot supply
Product Name: N-Z-L-Homoserine lactone Visit Supplier Webpage Request for quotationCAS: 35677-89-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: N-Z-L-Homoserine lactone Visit Supplier Webpage Request for quotationCAS: 35677-89-5
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History