1-BENZYL-1,4-DIAZEPANE
1-Benzylhomopiperazine
CAS: 4410-12-2
Molecular Formula: C12H18N2
1-BENZYL-1,4-DIAZEPANE - Names and Identifiers
| Name | 1-Benzylhomopiperazine |
| Synonyms | N-benzylhomopiperazine 1-BENZYL-1,4-DIAZEPANE N-Benzylhomopiperazine 1-BENZYLHOMOPIPERAZINE 1-Benzylhomopiperazine 1-benzyl-1,4-diazepane 1-BENZYL-1,4-DIAZACYCLOHEPTANE 1-Benzylhexahydro-1,4-diazepine 1-BENZYL(HEXAHYDRO)-1,4-DIAZEPINE 1-Benzyl-1,4-diazepane, 1-Benzylhexahydro-1,4-diazepine |
| CAS | 4410-12-2 |
| EINECS | 625-579-2 |
| InChI | InChI=1/C12H18N2/c1-2-5-12(6-3-1)11-14-9-4-7-13-8-10-14/h1-3,5-6,13H,4,7-11H2 |
| InChIKey | JTJTYCPQUOROFM-UHFFFAOYSA-N |
1-BENZYL-1,4-DIAZEPANE - Physico-chemical Properties
| Molecular Formula | C12H18N2 |
| Molar Mass | 190.28 |
| Density | 1.028g/mLat 25°C |
| Melting Point | 54-56 °C |
| Boling Point | 93 °C |
| Flash Point | >230°F |
| Vapor Presure | 0.00263mmHg at 25°C |
| BRN | 147009 |
| pKa | 10.59±0.20(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Sensitive | Air Sensitive |
| Refractive Index | n20/D 1.547 |
1-BENZYL-1,4-DIAZEPANE - Risk and Safety
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | 2735 |
| WGK Germany | 2 |
| HS Code | 29339900 |
| Hazard Note | Irritant |
| Hazard Class | 8 |
| Packing Group | III |
