Name | 2,3-Naphthalenedicarboxylic acid |
Synonyms | NSC 16063 NAPHTHALICACID 2,3-NAPHTHALICACID ARECHEM AL BO 0619 RARECHEM AL BO 0619 Naphthalin-2,3-dicarbonsure naphthalene-2,3-dicarboxylate 2,3-NAPHTHALENEDICARBOXYLIC ACID 2,3-Naphthalenedicarboxylic acid NAPHTHALENE-2,3-DICARBOXYLIC ACID naphthalene-2,3-dicarboxylic acid |
CAS | 2169-87-1 |
EINECS | 218-517-7 |
InChI | InChI=1/C12H8O4/c13-11(14)9-5-7-3-1-2-4-8(7)6-10(9)12(15)16/h1-6H,(H,13,14)(H,15,16)/p-2 |
InChIKey | KHARCSTZAGNHOT-UHFFFAOYSA-N |
Molecular Formula | C12H8O4 |
Molar Mass | 216.19 |
Density | 1.3023 (rough estimate) |
Melting Point | 238-240 °C (dec.) (lit.) |
Boling Point | 316.6°C (rough estimate) |
Flash Point | 214.4°C |
Vapor Presure | 2.27E-07mmHg at 25°C |
Appearance | Solid |
Color | Off-white |
BRN | 1967507 |
pKa | 2.95±0.30(Predicted) |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.7080 (estimate) |
MDL | MFCD00004104 |
Hazard Symbols | Xi - Irritant |
Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
WGK Germany | 3 |
HS Code | 29173995 |
WGK Germany | 3 |
customs code | 29173995 |
EPA chemical information | information provided by: ofmpub.epa.gov (external link) |
storage conditions | Sealed in dry,Room Temperature |
acidity coefficient (pKa) | 2.95±0.30(Predicted) |
BRN | 1967507 |
InChIKey | KHARCSTZAGNHOT-UHFFFAOYSA-N |
EPA chemical information | 2,3-Naphthalenedicarboxylic acid (2169-87-1) |