2,4-Pteridinediamine, 6-(bromomethyl)- - Names and Identifiers
Name | 6-Bromomethyl-2,4-pteridinediamine
|
Synonyms | 6-Bromomethyl-2,4-Diaminopteridine 6-Bromomethyl-2,4-diaminopteridine 6-Bromomethyl-2,4-pteridinediamine 2,4-Diamino-6-bromomethylpteridine 6-(bromomethyl)pteridine-2,4-diamine 6-(Bromomethyl)-2,4-pteridinediamine 6-(Bromomethyl)pteridine-2,4-diamine 2,4-PteridinediaMine, 6-(broMoMethyl)- 2,4-Pteridinediamine, 6-(bromomethyl)-
|
CAS | 59368-16-0
|
EINECS | 1592732-453-0 |
InChI | InChI=1/C7H7BrN6/c8-1-3-2-11-6-4(12-3)5(9)13-7(10)14-6/h2H,1H2,(H4,9,10,11,13,14) |
2,4-Pteridinediamine, 6-(bromomethyl)- - Physico-chemical Properties
Molecular Formula | C7H7BrN6
|
Molar Mass | 255.07 |
Density | 1.954 |
Melting Point | 168-170 °C |
Boling Point | 520.7±60.0 °C(Predicted) |
Flash Point | 268.7°C |
Vapor Presure | 6.08E-11mmHg at 25°C |
pKa | 5.51±0.10(Predicted) |
Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
Refractive Index | 1.835 |
2,4-Pteridinediamine, 6-(bromomethyl)- - Introduction
6-Bromomethyl-2, 4-pteridineamine is an organic compound with the chemical formula C8H9BrN4. The following is a description of the properties, uses, preparation and safety information of the compound:
Nature:
1. Appearance: 6-Bromomethyl-2,4-pteridinediamine is a white solid.
2. Melting point: The melting point of the compound is 100-102°C.
3. Solubility: 6-Bromomethyl-2,4-pteridinediamine is soluble in some organic solvents, such as ethanol and methanol.
Use:
1. as a pharmaceutical intermediate: 6-Bromomethyl-2,4-pteridinediamine can be used in the synthesis of some pharmaceutical compounds, with potential anti-tumor and antiviral activity.
Preparation Method:
At present, there are few preparation methods for 6-Bromomethyl-2,4-pteridinediamine, but a common preparation method is as follows:
3-amino -2, 4-pteridinol and hydrobromic acid are reacted to obtain 6-(bromomethyl)-2,4-pteridinol. This alcohol is then reacted with sodium bisulfite to give 6-Bromomethyl-2,4-pteridinediamine.
Safety Information:
1. 6-Bromomethyl-2, 4-pteridineamine is an organic compound. It is necessary to pay attention to protective measures and wear appropriate personal protective equipment during operation and storage.
2. The compound may be irritating to the skin and eyes and should be avoided. In case of accidental contact, rinse immediately with plenty of water.
3. Avoid inhaling the dust or gas of the compound, and operate in a well-ventilated place.
4. Please store properly and separate from other chemicals to avoid fire and high temperature.
Last Update:2024-04-09 19:05:50