2,6-dibromo-4,4-bis(2-ethylhexyl)-4h-cyclopenta(2,1-b:3,4-b')dithiophene - Names and Identifiers
Name | 2,6-dibromo-4,4-bis(2-ethylhexyl)-4h-cyclopenta(2,1-b:3,4-b')dithiophene
|
Synonyms | K0100 DBCPDP 2,6-dibromo-4,4-di-(2-ethylhexyl)-4H-cyclopenta[2,1-b 2,6-Dibromo-4,4-bis(2-ethylhexyl)-4H-cyclopenta[2,1-b
|
CAS | 365547-21-3
|
InChI | InChI=1S/C25H36Br2S2/c1-5-9-11-17(7-3)15-25(16-18(8-4)12-10-6-2)19-13-21(26)28-23(19)24-20(25)14-22(27)29-24/h13-14,17-18H,5-12,15-16H2,1-4H3 |
2,6-dibromo-4,4-bis(2-ethylhexyl)-4h-cyclopenta(2,1-b:3,4-b')dithiophene - Physico-chemical Properties
Molecular Formula | C25H36Br2S2
|
Molar Mass | 560.49 |
Density | 1.297 |
Boling Point | 552.1±50.0 °C(Predicted) |
Odor | Yellow oil |
Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
2,6-dibromo-4,4-bis(2-ethylhexyl)-4h-cyclopenta(2,1-b:3,4-b')dithiophene - Introduction
2,6-dibromo-4,4-bis(2-ethylhexyl)-4h-cyclopenta(2,1-b:3,4-b ')dithiophene is an organic compound with the following properties:
1. Appearance: Light yellow crystalline solid.
2. molecular formula: C28H38Br2S2.
3. Molecular weight: 636.55g/mol.
4. melting point: about 230-235 degrees Celsius.
5. Solubility: Soluble in common organic solvents such as chloroform, toluene and dichloromethane.
This compound is widely used in the field of organic solar cells as an organic semiconductor material for a light absorption layer. It has high molecular molar mass, high electron mobility, light stability and light absorption range. Its applications also include organic field effect transistors, light-emitting diodes, etc.
in terms of preparation method, a common synthesis method is to generate 2,6-dibromo -4,4-dioctyl-4H-cyclopenta [2,1-b:3,4-b '] dithiophene through bonding reaction between thiophene monomer and bromoethane, and then replace octyl group with 2-ethylhexyl group through bromination reaction.
During use and handling, attention should be paid to the safety of the substance. It may cause irritation to the eyes, skin and respiratory system, so wear appropriate protective equipment. In addition, the operation should be carried out in a well-ventilated place to avoid inhalation or contact. If inadvertently ingested or inhaled, seek medical attention immediately and identify the substance with the packaging or label.
Last Update:2024-04-10 22:29:15