2-(4-(Benzyloxy)phenyl)-N-methylethanamine
2-(4-(Benzyloxy)phenyl)-N-methylethanamine
CAS: 38961-21-6
Molecular Formula: C16H19NO
2-(4-(Benzyloxy)phenyl)-N-methylethanamine - Names and Identifiers
| Name | 2-(4-(Benzyloxy)phenyl)-N-methylethanamine |
| Synonyms | N-Methyl-4-(benzyloxy)phenethylamine N-Methyl-4-(benzyloxy)-benzeneethanamine N-Methyl-4-(benzyloxy)-benzeneethanaMine 2-(4-(Benzyloxy)phenyl)-N-methylethanamine [2-(4-BENZYLOXY-PHENYL)-ETHYL]-METHYL-AMINE Benzeneethanamine, N-methyl-4-(phenylmethoxy)- |
| CAS | 38961-21-6 |
| InChI | InChI=1/C16H19NO/c1-17-12-11-14-7-9-16(10-8-14)18-13-15-5-3-2-4-6-15/h2-10,17H,11-13H2,1H3 |
2-(4-(Benzyloxy)phenyl)-N-methylethanamine - Physico-chemical Properties
| Molecular Formula | C16H19NO |
| Molar Mass | 241.33 |
| Density | 1.038 |
| Boling Point | 371.8±22.0 °C(Predicted) |
| Flash Point | 155.342°C |
| Vapor Presure | 0mmHg at 25°C |
| pKa | 10.38±0.10(Predicted) |
| Refractive Index | 1.561 |
2-(4-(Benzyloxy)phenyl)-N-methylethanamine - Introduction
2-(4-(Benzyloxy)phenyl)-N-methylethanamine is an organic compound with the chemical formula C15H17NO and a molecular weight of 231.30g/mol. The following is a detailed description of the properties, uses, preparation and safety information of the compound:
Nature:
1. Appearance: 2-(4-(Benzyloxy)phenyl)-N-methylethanamine is white crystal or crystalline powder.
2. Solubility: Soluble in common organic solvents (such as ethanol, acetone, dimethyl sulfoxide, etc.).
3. Melting point: about 70-75°C.
4. Stability: Under normal conditions, such as air and light at room temperature, the compound is relatively stable.
Use:
1. Pharmaceutical field: 2-(4-(Benzyloxy)phenyl)-N-methylethanamine is a phenylethylamine compound, which can be used to synthesize biologically active compounds, such as antidepressants.
2. research purposes: the compound can be used as a reagent for the study of chemical reactions, synthetic methods and biological activities.
Preparation Method:
2-(4-(Benzyloxy)phenyl)-N-methylethanamine has many preparation methods, and a commonly used method is:
4-bromobenzyl ether reacts with 4-benzyloxyaniline to produce 2-(4-(benzyloxy) phenyl) ethanol, and then reacts with methylethylamine under alkaline conditions to obtain 2-(4-(Benzyloxy)phenyl)-N-methylethanamine.
Safety Information:
1. the compound should avoid direct contact with skin, eyes and respiratory tract.
2. Wear appropriate personal protective equipment such as gloves and goggles when using or handling the compound.
3. should be operated in a well-ventilated place to avoid inhalation of dust or gas.
4. If exposed or inhaled, seek medical advice immediately and provide detailed chemical composition and safety data.
Nature:
1. Appearance: 2-(4-(Benzyloxy)phenyl)-N-methylethanamine is white crystal or crystalline powder.
2. Solubility: Soluble in common organic solvents (such as ethanol, acetone, dimethyl sulfoxide, etc.).
3. Melting point: about 70-75°C.
4. Stability: Under normal conditions, such as air and light at room temperature, the compound is relatively stable.
Use:
1. Pharmaceutical field: 2-(4-(Benzyloxy)phenyl)-N-methylethanamine is a phenylethylamine compound, which can be used to synthesize biologically active compounds, such as antidepressants.
2. research purposes: the compound can be used as a reagent for the study of chemical reactions, synthetic methods and biological activities.
Preparation Method:
2-(4-(Benzyloxy)phenyl)-N-methylethanamine has many preparation methods, and a commonly used method is:
4-bromobenzyl ether reacts with 4-benzyloxyaniline to produce 2-(4-(benzyloxy) phenyl) ethanol, and then reacts with methylethylamine under alkaline conditions to obtain 2-(4-(Benzyloxy)phenyl)-N-methylethanamine.
Safety Information:
1. the compound should avoid direct contact with skin, eyes and respiratory tract.
2. Wear appropriate personal protective equipment such as gloves and goggles when using or handling the compound.
3. should be operated in a well-ventilated place to avoid inhalation of dust or gas.
4. If exposed or inhaled, seek medical advice immediately and provide detailed chemical composition and safety data.
Last Update：2024-04-09 02:00:45
