2-Chloro-N-(m-methoxyphenethyl)acetamide
2-Chloro-N-[2-(3-methoxyphenyl)ethyl]acetamide
CAS: 34162-12-4
Molecular Formula: C11H14ClNO2
2-Chloro-N-(m-methoxyphenethyl)acetamide - Names and Identifiers
| Name | 2-Chloro-N-[2-(3-methoxyphenyl)ethyl]acetamide |
| Synonyms | 2-Chloro-N-(m-methoxyphenethyl)acetamide Acetamide, 2-chloro-N-(m-methoxyphenethyl)- 2-Chloro-N-[2-(3-methoxyphenyl)ethyl]acetamide 2-Chloro-N-[2-(3-methoxyphenyl)ethyl]-acetamide 2-CHLORO-N-[2-(3-METHOXYPHENYL)ETHYL]-ACETAMIDE 2-chloro-N-[2-(3-methoxyphenyl)ethyl]ethanamide acetamide, 2-chloro-N-[2-(3-methoxyphenyl)ethyl]- |
| CAS | 34162-12-4 |
| InChI | InChI=1/C11H14ClNO2/c1-15-10-4-2-3-9(7-10)5-6-13-11(14)8-12/h2-4,7H,5-6,8H2,1H3,(H,13,14) |
2-Chloro-N-(m-methoxyphenethyl)acetamide - Physico-chemical Properties
| Molecular Formula | C11H14ClNO2 |
| Molar Mass | 227.69 |
| Density | 1.158±0.06 g/cm3(Predicted) |
| Boling Point | 416.9±35.0 °C(Predicted) |
| Flash Point | 205.9°C |
| Vapor Presure | 3.7E-07mmHg at 25°C |
| pKa | 14.03±0.46(Predicted) |
| Refractive Index | 1.524 |
2-Chloro-N-(m-methoxyphenethyl)acetamide - Risk and Safety
| Hazard Class | IRRITANT |
2-Chloro-N-(m-methoxyphenethyl)acetamide - Introduction
2-Chloro-N-[2-(3-methoxyphenyl)ethyl]acetamide is an organic compound with the formula C11H14ClNO2, which is a white crystalline solid.
Nature:
-Appearance: White crystalline solid
-Melting point: about 100-102°C
-Solubility: Soluble in organic solvents such as ethanol, dimethyl sulfoxide and dichloromethane, insoluble in water.
Use:
2-Chloro-N-[2-(3-methoxyphenyl)ethyl]acetamide is useful as an intermediate compound for pharmaceutical synthesis.
It can be used to synthesize imidazole compounds and other carboxylic acid activating reagents in organic synthesis reactions.
Preparation Method:
The preparation of 2-Chloro-N-[2-(3-methoxyphenyl)ethyl]acetamide can be carried out by the following steps:
1. 2-chloroacetyl chloride (2-chloroacetyl chloride) was added to methoxyphenethylamine (3-methoxyphenethylamine) in an ice bath.
2. Stir the reaction mixture at room temperature until the reaction is complete.
3. After solvent application and cooling, the product was crystallized and filtered.
4. The product was further purified to give pure 2-Chloro-N-[2-(3-methoxyphenyl)ethyl]acetamide.
Safety Information:
Note the following safety precautions when handling and storing 2-Chloro-N-[2-(3-methoxyphenyl)ethyl]acetamide:
-Avoid direct contact with skin and eyes and use personal protective equipment (e. g. gloves, glasses).
-Operate in a well-ventilated place to avoid inhaling vapors.
-avoid contact with oxidants, strong alkali and other substances.
-Store in a dry, cool place, away from fire and flammable materials.
Nature:
-Appearance: White crystalline solid
-Melting point: about 100-102°C
-Solubility: Soluble in organic solvents such as ethanol, dimethyl sulfoxide and dichloromethane, insoluble in water.
Use:
2-Chloro-N-[2-(3-methoxyphenyl)ethyl]acetamide is useful as an intermediate compound for pharmaceutical synthesis.
It can be used to synthesize imidazole compounds and other carboxylic acid activating reagents in organic synthesis reactions.
Preparation Method:
The preparation of 2-Chloro-N-[2-(3-methoxyphenyl)ethyl]acetamide can be carried out by the following steps:
1. 2-chloroacetyl chloride (2-chloroacetyl chloride) was added to methoxyphenethylamine (3-methoxyphenethylamine) in an ice bath.
2. Stir the reaction mixture at room temperature until the reaction is complete.
3. After solvent application and cooling, the product was crystallized and filtered.
4. The product was further purified to give pure 2-Chloro-N-[2-(3-methoxyphenyl)ethyl]acetamide.
Safety Information:
Note the following safety precautions when handling and storing 2-Chloro-N-[2-(3-methoxyphenyl)ethyl]acetamide:
-Avoid direct contact with skin and eyes and use personal protective equipment (e. g. gloves, glasses).
-Operate in a well-ventilated place to avoid inhaling vapors.
-avoid contact with oxidants, strong alkali and other substances.
-Store in a dry, cool place, away from fire and flammable materials.
Last Update：2024-04-09 15:17:56
