2-Methyl-Benzothiazole-5-Carboxylic Acid(WX614018) - Names and Identifiers
Name | 2-methyl-1,3-benzothiazole-5-carboxylic acid
|
Synonyms | 5-Benzothiazolecarboxylic acid, 2-methyl- 2-Methylbenzo[d]thiazole-5-carboxylic acid 2-methyl-1,3-benzothiazole-5-carboxylic acid 2-Methyl-1,3-benzothiazole-5-carboxylic acid 2-Methyl-1,3-benzothiazole-5-carboxylic Acid 5-Benzothiazolecarboxylicacid,2-methyl-(8CI,9CI) 2-Methyl-Benzothiazole-5-Carboxylic Acid(WX614018)
|
CAS | 24851-69-2
|
InChI | InChI=1/C9H7NO2S/c1-5-10-7-4-6(9(11)12)2-3-8(7)13-5/h2-4H,1H3,(H,11,12) |
2-Methyl-Benzothiazole-5-Carboxylic Acid(WX614018) - Physico-chemical Properties
Molecular Formula | C9H7NO2S
|
Molar Mass | 193.22 |
Density | 1.430±0.06 g/cm3(Predicted) |
Melting Point | 202 °C |
Boling Point | 385.2±15.0 °C(Predicted) |
Flash Point | 186.8°C |
Vapor Presure | 1.27E-06mmHg at 25°C |
pKa | 3.61±0.30(Predicted) |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.702 |
2-Methyl-Benzothiazole-5-Carboxylic Acid(WX614018) - Introduction
2-methyl-1, acid(2-methyl-1, acid) is an organic compound with the chemical formula C9H7NO2S.
The properties of the compound are as follows:
Appearance: Colorless or slightly yellow crystalline powder
Melting Point: 177-179 ℃
Density: 1.437g/cm3
solubility: soluble in acid, slightly soluble in alcohol and ether
Stability: stable, not easy to decompose at room temperature
2-methyl-1, acid has certain applications in medicine and organic synthesis:
1. Pharmaceutical field: It can be used to synthesize compounds with biological activity, such as antifungal drugs, antitumor drugs, etc.
2. Field of organic synthesis: can be used as a synthetic intermediate for the synthesis of other organic compounds.
The method for preparing 2-methyl-1, m-acid is as follows:
First, a 2-methylbenzothiazole-containing compound is reacted with a base to produce a 2-methylbenzothiazole ammonium salt. Then, by reacting with an acid, 2-methyl-1, m acid can be obtained.
Regarding safety information, 2-methyl-1, acid is less dangerous, but the following matters still need to be paid attention:
1. Wear personal protective equipment such as safety glasses and gloves to avoid contact with skin and eyes.
2. Avoid inhaling dust and operate in a well-ventilated place.
3. Keep dry during storage and avoid contact with oxidants and strong acids.
4. If accidental contact or eating, should immediately rinse with plenty of water, and immediately seek medical treatment.
Last Update:2024-04-09 21:01:54