2-Phenoxybenzyl alcohol
2-Phenoxybenzyl alcohol
CAS: 13807-84-6
Molecular Formula: C13H12O2
2-Phenoxybenzyl alcohol - Names and Identifiers
| Name | 2-Phenoxybenzyl alcohol |
| Synonyms | RARECHEM AL BD 1507 2-PHENOXYBENZYL ALCOHOL 2-Phenoxybenzyl alcohol (2-PHENOXYPHENYL)METHANOL (2-phenoxyphenyl)methanol Benzenemethanol, 2-phenoxy- (2-Phenoxyphenyl)methanol, 2-(Hydroxymethyl)diphenyl ether |
| CAS | 13807-84-6 |
| InChI | InChI=1/C13H12O2/c14-10-11-6-4-5-9-13(11)15-12-7-2-1-3-8-12/h1-9,14H,10H2 |
2-Phenoxybenzyl alcohol - Physico-chemical Properties
| Molecular Formula | C13H12O2 |
| Molar Mass | 200.23 |
| Density | 1.151±0.06 g/cm3(Predicted) |
| Boling Point | 135 °C(Press: 1.2 Torr) |
| Flash Point | 140.6°C |
| Vapor Presure | 0.000126mmHg at 25°C |
| pKa | 14.37±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.595 |
2-Phenoxybenzyl alcohol - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Hazard Class | IRRITANT |
2-Phenoxybenzyl alcohol - Introduction
o-Phenoxybenzyl alcohol, chemical formula C6H4(OH)(OC6H5), is an organic compound. It is a white solid, soluble in alcohol and ether solvents, insoluble in water.
Next is about the properties of o-phenoxybenzyl alcohol:
1. It has a fragrant smell.
2. It is a free radical inhibitor, which can inhibit the oxidation reaction of oxygen free radicals to substances.
3. It is a phenolic compound with certain antibacterial, antiseptic and antioxidant properties.
4. It can be used to synthesize other organic compounds, such as fluorescent dyes, pesticides, etc.
o-phenoxybenzyl alcohol preparation method generally has the following several methods:
1. catechol reacts with benzaldehyde to generate o-phenoxybenzyl alcohol after condensation reaction.
2. o-Phenol reacts with p-formaldehyde to generate o-phenoxybenzyl alcohol under appropriate conditions.
Safety information about o-phenoxybenzyl alcohol:
1. o-phenoxybenzyl alcohol has a certain toxicity, contact should avoid inhalation or contact with the skin.
2. Use should wear appropriate personal protective equipment, such as gloves, glasses, etc.
3. Storage should avoid contact with oxidants, acids and other substances to prevent dangerous reactions.
4. in case of accidental contact or misuse, please seek medical treatment in time.
Next is about the properties of o-phenoxybenzyl alcohol:
1. It has a fragrant smell.
2. It is a free radical inhibitor, which can inhibit the oxidation reaction of oxygen free radicals to substances.
3. It is a phenolic compound with certain antibacterial, antiseptic and antioxidant properties.
4. It can be used to synthesize other organic compounds, such as fluorescent dyes, pesticides, etc.
o-phenoxybenzyl alcohol preparation method generally has the following several methods:
1. catechol reacts with benzaldehyde to generate o-phenoxybenzyl alcohol after condensation reaction.
2. o-Phenol reacts with p-formaldehyde to generate o-phenoxybenzyl alcohol under appropriate conditions.
Safety information about o-phenoxybenzyl alcohol:
1. o-phenoxybenzyl alcohol has a certain toxicity, contact should avoid inhalation or contact with the skin.
2. Use should wear appropriate personal protective equipment, such as gloves, glasses, etc.
3. Storage should avoid contact with oxidants, acids and other substances to prevent dangerous reactions.
4. in case of accidental contact or misuse, please seek medical treatment in time.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: (2-PHENOXYPHENYL)METHANOL Visit Supplier Webpage Request for quotation
CAS: 13807-84-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 13807-84-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: (2-PHENOXYPHENYL)METHANOL Visit Supplier Webpage Request for quotation
CAS: 13807-84-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 13807-84-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History