2-Propanol, 1-(isopropylamino)-3-(1-naphthyloxy)- (7CI, 8CI)
propranolol
CAS: 525-66-6
Molecular Formula: C16H21NO2
2-Propanol, 1-(isopropylamino)-3-(1-naphthyloxy)- (7CI, 8CI) - Names and Identifiers
| Name | propranolol |
| Synonyms | Propanolol propranolol Propranolol Base 1-isopropylamino-3-(1-naphthyloxy)propan-2-ol 1-[Isopropylamino]-3-[1-naphthyloxy]-2-propanol 1-(1-Naphthyloxy)-3-(isopropylamino)-2-propanol 1-Isopropylamino-3-(naphthalen-1-yloxy)-propan-2-ol 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol 2-Propanol, 1-(1-methylethyl)amino-3-(1-naphthalenyloxy)- 2-Propanol, 1-(isopropylamino)-3-(1-naphthyloxy)- (7CI, 8CI) 2-Propanol, 1-[(1-methylethyl)amino]-3-(1-naphthalenyloxy)- (9CI) |
| CAS | 525-66-6 |
| EINECS | 208-378-0 |
| InChI | InChI=1/C16H21NO2/c1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16/h3-9,12,14,17-18H,10-11H2,1-2H3 |
2-Propanol, 1-(isopropylamino)-3-(1-naphthyloxy)- (7CI, 8CI) - Physico-chemical Properties
| Molecular Formula | C16H21NO2 |
| Molar Mass | 259.34 |
| Density | 1.0280 (rough estimate) |
| Melting Point | 163-164 °C |
| Boling Point | 402.6°C (rough estimate) |
| Water Solubility | 80.99mg/L(25 ºC) |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Appearance | Solid |
| Color | White to Off-White |
| pKa | 13.84±0.20(Predicted) |
| Storage Condition | -20°C Freezer, Under inert atmosphere |
| Refractive Index | 1.5500 (estimate) |
