2-hydroxy-4-(methylamino)benzoic acid
2-hydroxy-4-(methylamino)benzoic acid
CAS: 6952-12-1
Molecular Formula: C8H9NO3
2-hydroxy-4-(methylamino)benzoic acid - Names and Identifiers
| Name | 2-hydroxy-4-(methylamino)benzoic acid |
| Synonyms | NSC 63019 4-(Methylamino)salicylic acid N-methyl-4-aminosalicylic acid 2-HYDROXY-4-(METHYLAMINO)BENZOIC ACID 2-hydroxy-4-(methylamino)benzoic acid 2-hydroxy-4-(methylamino)-Benzoic acid Benzoic acid,2-hydroxy-4-(methylamino)- |
| CAS | 6952-12-1 |
| InChI | InChI=1/C8H9NO3/c1-9-5-2-3-6(8(11)12)7(10)4-5/h2-4,9-10H,1H3,(H,11,12) |
2-hydroxy-4-(methylamino)benzoic acid - Physico-chemical Properties
| Molecular Formula | C8H9NO3 |
| Molar Mass | 167.16 |
| Density | 1.394±0.06 g/cm3(Predicted) |
| Melting Point | 126-127℃ (benzene ) |
| Boling Point | 368.0±37.0 °C(Predicted) |
| Flash Point | 176.3°C |
| Vapor Presure | 4.6E-06mmHg at 25°C |
| pKa | 3.67±0.10(Predicted) |
| Refractive Index | 1.668 |
2-hydroxy-4-(methylamino)benzoic acid - Introduction
2-hydroxy-4-(methylamino)benzoic acid is an organic compound with the chemical formula of C≡H≡N₂ O₂. The following is a description of its nature, use, preparation and safety information:
Nature:
-Appearance: 2-hydroxy-4-(methylamino)benzoic acid is colorless crystal or white crystalline powder.
-Solubility: The compound is soluble in hot water, ethanol and ether solvents, slightly soluble in cold water.
-acidity and alkalinity: 2-hydroxy-4-(methylamino)benzoic acid is weakly acidic in aqueous solution.
Use:
-Pharmaceutical field: 2-hydroxy-4-(methylamino)benzoic acid can be used to synthesize drugs, with antibacterial and anti-inflammatory effects.
-Cosmetics: It can also be used as an ingredient to adjust pH, antibacterial and antioxidant, and is widely used in skin care products and cosmetics.
Preparation Method:
2-hydroxy-4-(methylamino)benzoic acid can be synthesized by the following steps:
1. First, p-nitrotoluene was prepared by the reaction of nitrite with p-toluidine.
2. p-nitrotoluene reacts with formaldehyde under alkaline conditions to generate N-methyl p-nitrotoluene amine.
3. N-methyl p-nitrotoluene amine is hydrogenated with sodium hydroxide to generate N-methyl p-aminotoluene.
4. N-methyl p-aminotoluene reacts with m-hydroxybenzoic acid under acidic conditions to obtain the final product 2-hydroxy-4-(methylamino)benzoic acid.
Safety Information:
Nature:
-Appearance: 2-hydroxy-4-(methylamino)benzoic acid is colorless crystal or white crystalline powder.
-Solubility: The compound is soluble in hot water, ethanol and ether solvents, slightly soluble in cold water.
-acidity and alkalinity: 2-hydroxy-4-(methylamino)benzoic acid is weakly acidic in aqueous solution.
Use:
-Pharmaceutical field: 2-hydroxy-4-(methylamino)benzoic acid can be used to synthesize drugs, with antibacterial and anti-inflammatory effects.
-Cosmetics: It can also be used as an ingredient to adjust pH, antibacterial and antioxidant, and is widely used in skin care products and cosmetics.
Preparation Method:
2-hydroxy-4-(methylamino)benzoic acid can be synthesized by the following steps:
1. First, p-nitrotoluene was prepared by the reaction of nitrite with p-toluidine.
2. p-nitrotoluene reacts with formaldehyde under alkaline conditions to generate N-methyl p-nitrotoluene amine.
3. N-methyl p-nitrotoluene amine is hydrogenated with sodium hydroxide to generate N-methyl p-aminotoluene.
4. N-methyl p-aminotoluene reacts with m-hydroxybenzoic acid under acidic conditions to obtain the final product 2-hydroxy-4-(methylamino)benzoic acid.
Safety Information:
Last Update：2024-04-09 02:00:47
