2-propenoic acid, 3-(1-piperidinyl)-, ethyl ester, (2E)-
Ethyl3-(1-piperidinyl)acrylate
CAS: 19524-67-5
Molecular Formula: C10H17NO2
2-propenoic acid, 3-(1-piperidinyl)-, ethyl ester, (2E)- - Names and Identifiers
| Name | Ethyl3-(1-piperidinyl)acrylate |
| Synonyms | Ethyl3-(1-piperidinyl)acrylate (E)-ethyl 3-(piperidin-1-yl)acrylate Ethyl (2E)-3-(piperidin-1-yl)acrylate ethyl 3-(piperidin-1-yl)prop-2-enoate ethyl (2E)-3-(piperidin-1-yl)prop-2-enoate 3-(1-piperidinyl)-2-propenoic acid ethyl ester 2-Propenoic acid, 3-(1-piperidinyl)-, ethyl ester 2-propenoic acid, 3-(1-piperidinyl)-, ethyl ester, (2E)- |
| CAS | 19524-67-5 |
| InChI | InChI=1/C10H17NO2/c1-2-13-10(12)6-9-11-7-4-3-5-8-11/h6,9H,2-5,7-8H2,1H3/b9-6+ |
2-propenoic acid, 3-(1-piperidinyl)-, ethyl ester, (2E)- - Physico-chemical Properties
| Molecular Formula | C10H17NO2 |
| Molar Mass | 183.25 |
| Density | 1.079g/cm3 |
| Boling Point | 266.078°C at 760 mmHg |
| Flash Point | 100.856°C |
| Vapor Presure | 0.009mmHg at 25°C |
| Refractive Index | 1.541 |
2-propenoic acid, 3-(1-piperidinyl)-, ethyl ester, (2E)- - Introduction
Ethyl3-(1-piperidinyl)acrylate is an organic compound with the chemical formula C10H15NO2.
Nature:
1. Appearance: colorless liquid.
2. Solubility: Soluble in organic solvents such as ethanol, ether, etc.
3. Melting Point:-70 degrees Celsius.
4. Boiling point: 167-170 degrees Celsius.
Use:
1. Ethyl3-(1-piperidinyl)acrylate is commonly used in the synthesis of biologically active compounds.
2. It can also be used as a monomer for polymer materials to prepare polymer materials.
Method:
The preparation method of ethy3-(1-piperidinyl)acrylate is generally synthesized by chemical reaction, and the specific method includes the reaction of ethyl acetate or ethyl chloroacetate with 1-piperidine ethanol.
Safety Information:
1. Ethyl3-(1-piperidinyl)acrylate is an organic compound that is irritating and avoids direct contact with skin and eyes.
2. Wear protective gloves and goggles during use and maintain well-ventilated laboratory conditions.
3. If accidental contact or eating, should immediately seek medical attention.
Nature:
1. Appearance: colorless liquid.
2. Solubility: Soluble in organic solvents such as ethanol, ether, etc.
3. Melting Point:-70 degrees Celsius.
4. Boiling point: 167-170 degrees Celsius.
Use:
1. Ethyl3-(1-piperidinyl)acrylate is commonly used in the synthesis of biologically active compounds.
2. It can also be used as a monomer for polymer materials to prepare polymer materials.
Method:
The preparation method of ethy3-(1-piperidinyl)acrylate is generally synthesized by chemical reaction, and the specific method includes the reaction of ethyl acetate or ethyl chloroacetate with 1-piperidine ethanol.
Safety Information:
1. Ethyl3-(1-piperidinyl)acrylate is an organic compound that is irritating and avoids direct contact with skin and eyes.
2. Wear protective gloves and goggles during use and maintain well-ventilated laboratory conditions.
3. If accidental contact or eating, should immediately seek medical attention.
Last Update：2024-04-10 22:29:15
