2461-46-3
4,4'-bis(2,3-epoxypropoxy)biphenyl
CAS: 2461-46-3
Molecular Formula: C18H18O4
2461-46-3 - Names and Identifiers
| Name | 4,4'-bis(2,3-epoxypropoxy)biphenyl |
| Synonyms | Diglycidylether of 4,4'-biphenol 4,4'-bis(2,3-epoxypropoxy)biphenyl Biphenyl-4,4'-diylbis(glycidyl ether) 4,4'-Bis[(oxirane-2-yl)methoxy]-1,1'-biphenyl 3,3'-[Biphenyl-4,4'-diylbisoxy]bis(1,2-epoxypropane) 2,2'-[(4,4'-Biphenylylene)bis(oxymethylene)]bisoxirane 2,2'-[(1,1'-Biphenyl)-4,4'-diyl]bis(oxymethylene)bisoxirane Polymers of 4,4'-dihydroxy-1,1-biphenyl with(chloromethyl)oxirane Polymers of 4,4'-dihydroxy-1,1-biphenyl with (chloromethyl)oxirane |
| CAS | 2461-46-3 |
| EINECS | 219-556-2 |
| InChI | InChI=1/C18H18O4/c1-5-15(19-9-17-11-21-17)6-2-13(1)14-3-7-16(8-4-14)20-10-18-12-22-18/h1-8,17-18H,9-12H2 |
2461-46-3 - Physico-chemical Properties
| Molecular Formula | C18H18O4 |
| Molar Mass | 298.33 |
| Density | 1.226±0.06 g/cm3(Predicted) |
| Melting Point | 156 °C |
| Boling Point | 473.6±30.0 °C(Predicted) |
| Flash Point | 171.5°C |
| Vapor Presure | 1.11E-08mmHg at 25°C |
| Refractive Index | 1.587 |
2461-46-3 - Introduction
4,4 '-bis(2,3-epoxypropoxy)biphenyl, also known as 4,4'-bis(2,3-epoxypropoxy)biphenyl, is a polymer with special properties.
Its main properties are as follows:
1. It is a solid polymer with high molecular weight and high melting point;
2. It has good thermal stability and chemical resistance;
3. Its main functional group is epoxy group, which makes it show good performance in the process of reaction crosslinking and thermal curing;
4. It has good electrical insulation properties and mechanical strength.
This polymer has a variety of applications:
1. It can be used as a high-temperature adhesive and packaging material for fixing and protecting electronic components;
2. It can be used for surface coating to provide excellent corrosion resistance and chemical resistance;
3. It can be used to prepare high-temperature ceramic composites to improve their mechanical properties and heat resistance.
The preparation method of this polymer is to react 4,4 '-dihydroxy -1,1-biphenyl with chloromethyloxirane, and perform a ring-opening reaction of epoxy groups under alkaline conditions to form a polymer.
Regarding safety information, the safety assessment and use of polymers must follow relevant safety procedures. For example, during operation, it is necessary to wear appropriate protective gloves and personal protective equipment such as goggles to avoid direct contact with the polymer. When storing and handling polymers, correct safety practices need to be followed to ensure safety. When using, please read the product manual carefully and obtain more detailed safety information from the supplier.
Its main properties are as follows:
1. It is a solid polymer with high molecular weight and high melting point;
2. It has good thermal stability and chemical resistance;
3. Its main functional group is epoxy group, which makes it show good performance in the process of reaction crosslinking and thermal curing;
4. It has good electrical insulation properties and mechanical strength.
This polymer has a variety of applications:
1. It can be used as a high-temperature adhesive and packaging material for fixing and protecting electronic components;
2. It can be used for surface coating to provide excellent corrosion resistance and chemical resistance;
3. It can be used to prepare high-temperature ceramic composites to improve their mechanical properties and heat resistance.
The preparation method of this polymer is to react 4,4 '-dihydroxy -1,1-biphenyl with chloromethyloxirane, and perform a ring-opening reaction of epoxy groups under alkaline conditions to form a polymer.
Regarding safety information, the safety assessment and use of polymers must follow relevant safety procedures. For example, during operation, it is necessary to wear appropriate protective gloves and personal protective equipment such as goggles to avoid direct contact with the polymer. When storing and handling polymers, correct safety practices need to be followed to ensure safety. When using, please read the product manual carefully and obtain more detailed safety information from the supplier.
Last Update：2024-04-09 20:02:46
