3,4-Ethylendioxythiophen-2,5-dicarbonsure - Names and Identifiers
Name | 2,5-Dicarboxylic acid-3,4-ethylene dioxythiophene
|
Synonyms | 3,4-Ethylendioxythiophen-2,5-dicarbonsure 3,4-ETHYLENEDIOXOTHIOPHENE-2,5-DICARBOXYLIC ACID 2,5-Dicarboxylic acid-3,4-ethylenedioxythiophene 3,4-Ethylenedioxythiophene-2,5-dicarboxylic Acid 2,5-Dicarboxylic acid-3,4-ethylene dioxythiophene 2,3-Dihydro-thieno[3,4-b]-p-dioxin-5,7-dicarboxylic acid Thieno[3,4-B]-1,4-Dioxin-5,7-DicarboxylicAcid,2,3-Dihydro- 2,3-Dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarboxylic acid 2,3-dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarboxylic acid 2, 5 - dicarboxylic acid - 3, 4 - thiophene ethylene 2 oxygen
|
CAS | 18361-03-0 108347-23-5
|
EINECS | 201-215-5 |
InChI | InChI=1/C8H6O6S/c9-7(10)5-3-4(14-2-1-13-3)6(15-5)8(11)12/h1-2H2,(H,9,10)(H,11,12) |
3,4-Ethylendioxythiophen-2,5-dicarbonsure - Physico-chemical Properties
Molecular Formula | C8H6O6S
|
Molar Mass | 230.19 |
Density | 1.732±0.06 g/cm3(Predicted) |
Melting Point | 319.5-321.2 °C |
Boling Point | 482.6±45.0 °C(Predicted) |
Flash Point | 245.6°C |
Solubility | slightly sol. in Dimethylformamide |
Vapor Presure | 4.01E-10mmHg at 25°C |
Appearance | powder to crystal |
Color | White to Light yellow |
pKa | 3.56±0.20(Predicted) |
Storage Condition | Room Temprature |
Refractive Index | 1.663 |
3,4-Ethylendioxythiophen-2,5-dicarbonsure - Introduction
2,5-dicarboxylic acid-3,4-ethylene dioxythiophene (also known as EDOT) is an organic compound with the chemical formula C8H6O4S, which has blue to blue-black crystals. The following is a description of the nature, use, preparation and safety information of EDOT:
Nature:
1. Appearance: EDOT is blue to blue-black crystal, soluble in organic solvents such as ethanol, chloroform and dimethyl sulfoxide.
2. Melting Point: about 150 degrees Celsius.
3. Stability: EDOT is relatively stable at room temperature, but it is prone to oxidation reaction under high temperature, oxygen and light conditions.
Use:
1. Electrochemical field: EDOT is an important organic semiconductor material, which can be used to prepare organic conductive polymers and conductive materials.
2. In the field of Optoelectronics: Due to its absorption and luminescence capabilities in the visible light range, EDOT can be used to prepare organic photoelectric materials, such as organic photodiodes and organic solar cells.
3. Chemical Synthesis: EDOT is an important intermediate for the synthesis of organic molecules, often used in the synthesis of compounds with special functions.
Method:
Common preparation methods for EDOT include:
1. The intermediate 2,5-dimethyl pyrrolidone was obtained from the reaction of pyrrolidone and dimethyl sulfoxide, and then EDOT was obtained through acid treatment and sulfonation reaction.
2.3,4-ethylenedioxythiophene was obtained from the reaction of 3,4-benzothiophene and acetic acid, and then EDOT was obtained by oxidation reaction.
Safety Information:
EDOT is generally safer under normal use conditions, but the following safety precautions should be paid attention:
1. EDOT is an organic compound, which can irritate the skin and eyes. When in contact, pay attention to using protective gloves and goggles, and avoid directly touching the skin and inhaling its dust.
2. During the preparation and storage process, care should be taken to avoid contact with oxidants and strong acids to avoid accidental reactions.
3. EDOT should be stored in a dry, ventilated place, avoid direct sunlight, away from fire and flammable materials.
Last Update:2024-04-10 22:29:15