3-BROMOFLUORANTHENE fandachem
3-BROMOFLUORANTHENE
CAS: 13438-50-1
Molecular Formula: C16H9Br
3-BROMOFLUORANTHENE fandachem - Names and Identifiers
| Name | 3-BROMOFLUORANTHENE |
| Synonyms | 3-BROMOFLUORANTHENE Fluoranthene, 3-?bromo- 3-BROMOFLUORANTHENE fandachem |
| CAS | 13438-50-1 |
| EINECS | 808-043-4 |
| InChI | InChI=1/C16H9Br/c17-15-9-8-13-11-5-2-1-4-10(11)12-6-3-7-14(15)16(12)13/h1-9H |
3-BROMOFLUORANTHENE fandachem - Physico-chemical Properties
| Molecular Formula | C16H9Br |
| Molar Mass | 281.15 |
| Density | 1.578±0.06 g/cm3(Predicted) |
| Melting Point | 106.0 to 200.0 °C |
| Boling Point | 207°C/0.2mmHg(lit.) |
| Solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| Appearance | Solid |
| Color | Light Yellow to Yellow |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.858 |
3-BROMOFLUORANTHENE fandachem - Introduction
3-Bromofluoranthene is an organic compound with the chemical formula C20H11Br, which has the following properties:
1. appearance: 3-bromofluoranthene is orange crystal or powder.
2. Melting point: Its melting point is about 270-272 degrees Celsius.
3. solubility: 3-bromofluoranthene insoluble in water, but soluble in organic solvents such as ethanol, dichloromethane and benzene.
The main uses of 3-bromofluoranthene are as follows:
1. Fluorescent probe: It can be used as a fluorescent probe to study intermolecular interactions, fluorescence resonance energy transfer and other phenomena.
2. Chemical reagents: In chemical experiments, 3-bromofluoranthene can be used to synthesize other compounds, or as dyes and indicators.
3. treatment of leukemia: 3-bromofluoranthene is also studied as a drug for the treatment of leukemia.
The method for preparing 3-bromofluoranthene generally includes the following steps:
1. First, fluoranthene reacts with ferric bromide to generate 3-bromofluoranthene.
2. Then, after appropriate purification and crystallization steps, the pure 3-bromofluoranthene product is obtained.
The following safety information is required when using 3-bromofluoranthene:
1. avoid contact with skin and eyes: use should wear appropriate protective gloves and goggles, avoid direct contact with 3-bromofluoranthene.
2. avoid inhalation: should be operated in a well-ventilated laboratory environment, avoid inhalation of 3-bromofluoranthene dust or vapor.
3. Storage Note: 3-Bromofluoranthene should be stored in a dry, cool place, away from fire and oxidant.
1. appearance: 3-bromofluoranthene is orange crystal or powder.
2. Melting point: Its melting point is about 270-272 degrees Celsius.
3. solubility: 3-bromofluoranthene insoluble in water, but soluble in organic solvents such as ethanol, dichloromethane and benzene.
The main uses of 3-bromofluoranthene are as follows:
1. Fluorescent probe: It can be used as a fluorescent probe to study intermolecular interactions, fluorescence resonance energy transfer and other phenomena.
2. Chemical reagents: In chemical experiments, 3-bromofluoranthene can be used to synthesize other compounds, or as dyes and indicators.
3. treatment of leukemia: 3-bromofluoranthene is also studied as a drug for the treatment of leukemia.
The method for preparing 3-bromofluoranthene generally includes the following steps:
1. First, fluoranthene reacts with ferric bromide to generate 3-bromofluoranthene.
2. Then, after appropriate purification and crystallization steps, the pure 3-bromofluoranthene product is obtained.
The following safety information is required when using 3-bromofluoranthene:
1. avoid contact with skin and eyes: use should wear appropriate protective gloves and goggles, avoid direct contact with 3-bromofluoranthene.
2. avoid inhalation: should be operated in a well-ventilated laboratory environment, avoid inhalation of 3-bromofluoranthene dust or vapor.
3. Storage Note: 3-Bromofluoranthene should be stored in a dry, cool place, away from fire and oxidant.
Last Update：2024-04-09 21:21:28
Supplier List
Product Name: 3-bromofluoranthene Visit Supplier Webpage Request for quotation
CAS: 13438-50-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 13438-50-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 3-bromofluoranthene Visit Supplier Webpage Request for quotation
CAS: 13438-50-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 13438-50-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History