3-Dibenzofurancarboxylic acid, 2-hydroxy-
2-hydroxydibenzofuran-3-carboxylic acid
CAS: 118-36-5
Molecular Formula: C13H8O4
3-Dibenzofurancarboxylic acid, 2-hydroxy- - Names and Identifiers
| Name | 2-hydroxydibenzofuran-3-carboxylic acid |
| Synonyms | 3-hydroxy-2-carboxydibenzofuran 2-Hydroxy-dibenzofuran-3-carbonsure 2-hydroxydibenzofuran-3-carboxylic acid 2-Hydroxy-3-dibenzofurancarboxylic acid 3-Dibenzofurancarboxylic acid, 2-hydroxy- |
| CAS | 118-36-5 |
| EINECS | 204-247-7 |
| InChI | InChI=1/C13H8O4/c14-10-5-8-7-3-1-2-4-11(7)17-12(8)6-9(10)13(15)16/h1-6,14H,(H,15,16) |
3-Dibenzofurancarboxylic acid, 2-hydroxy- - Physico-chemical Properties
| Molecular Formula | C13H8O4 |
| Molar Mass | 228.2 |
| Density | 1.507g/cm3 |
| Boling Point | 459.1°C at 760 mmHg |
| Flash Point | 231.4°C |
| Vapor Presure | 3.19E-09mmHg at 25°C |
| Refractive Index | 1.772 |
3-Dibenzofurancarboxylic acid, 2-hydroxy- - Introduction
2-Hydroxydibenzofuran -3-carboxylic acid, also known as Izide. The following is a description of its nature, use, formulation and safety information:
Nature:
1. Appearance: 2-hydroxydibenzofuran-3-carboxylic acid is a white to light yellow crystalline powder.
2. Chemical properties: 2-hydroxy dibenzofuran -3-carboxylic acid is alkaline and acidic, soluble in some organic solvents, such as ethanol and dichloromethane.
Use:
1. Pharmaceutical field: 2-hydroxydibenzofuran-3-carboxylic acid is an important intermediate for the synthesis of biologically active compounds.
2. Pesticide field: It can also be used to synthesize some pesticides and herbicides.
Preparation Method:
The preparation method of 2-hydroxydibenzofuran-3-carboxylic acid can be carried out by the following steps:
1. 2-chlorodibenzofuran (2-chlorodibenzofuran) is reacted with sodium hydroxide to obtain 2-hydroxydibenzofuran (2-hydroxydibenzofuran).
2. React 2-hydroxydibenzofuran with an organic acid (such as propionic acid) to obtain 2-hydroxydibenzofuran-3-carboxylic acid.
Safety Information:
1. 2-Hydroxydibenzofuran-3-carboxylic acid requires protection during handling and storage to avoid contact with eyes, skin and clothing.
2. Wear protective gloves, protective glasses and dust masks when using, and maintain good ventilation conditions.
3. If the compound is accidentally ingested or inhaled, seek medical attention immediately and bring the container or label with you.
4. Please properly store 2-hydroxydibenzofuran-3-carboxylic acid and store it in a cool, dry and ventilated place, away from fire and oxidizing agents.
Nature:
1. Appearance: 2-hydroxydibenzofuran-3-carboxylic acid is a white to light yellow crystalline powder.
2. Chemical properties: 2-hydroxy dibenzofuran -3-carboxylic acid is alkaline and acidic, soluble in some organic solvents, such as ethanol and dichloromethane.
Use:
1. Pharmaceutical field: 2-hydroxydibenzofuran-3-carboxylic acid is an important intermediate for the synthesis of biologically active compounds.
2. Pesticide field: It can also be used to synthesize some pesticides and herbicides.
Preparation Method:
The preparation method of 2-hydroxydibenzofuran-3-carboxylic acid can be carried out by the following steps:
1. 2-chlorodibenzofuran (2-chlorodibenzofuran) is reacted with sodium hydroxide to obtain 2-hydroxydibenzofuran (2-hydroxydibenzofuran).
2. React 2-hydroxydibenzofuran with an organic acid (such as propionic acid) to obtain 2-hydroxydibenzofuran-3-carboxylic acid.
Safety Information:
1. 2-Hydroxydibenzofuran-3-carboxylic acid requires protection during handling and storage to avoid contact with eyes, skin and clothing.
2. Wear protective gloves, protective glasses and dust masks when using, and maintain good ventilation conditions.
3. If the compound is accidentally ingested or inhaled, seek medical attention immediately and bring the container or label with you.
4. Please properly store 2-hydroxydibenzofuran-3-carboxylic acid and store it in a cool, dry and ventilated place, away from fire and oxidizing agents.
Last Update：2024-04-09 19:05:45
