3-Fluoroisatoic Anhydride
3-Fluoroisatoic Anhydride
CAS: 174463-53-7
Molecular Formula: C8H4FNO3
3-Fluoroisatoic Anhydride - Names and Identifiers
| Name | 3-Fluoroisatoic Anhydride |
| Synonyms | 8-Fluoroisatoic anhydride 3-Fluoroisatoic Anhydride 8-FLUORO-2H-3,1-BENZOXAZINE-2,4(1H)-DIONE 8-Fluoro-2H-3,1-Benzoxazine-2,4(1H)-Dione 2H-3,1-Benzoxazine-2,4(1H)-dione, 8-fluoro- 8-fluoro-2H-benzo[d][1,3]oxazine-2,4(1H)-dione 8-Fluoro-2H-3,1-benzoxazine-2,4(1H)-dione, 8-Fluoro-1H-benzo[d][1,3]oxazine-2,4-dione |
| CAS | 174463-53-7 |
| InChI | InChI=1/C8H4FNO3/c9-5-3-1-2-4-6(5)10-8(12)13-7(4)11/h1-3H,(H,10,12) |
3-Fluoroisatoic Anhydride - Physico-chemical Properties
| Molecular Formula | C8H4FNO3 |
| Molar Mass | 181.12 |
| Density | 1.503g/cm3 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.561 |
3-Fluoroisatoic Anhydride - Introduction
3-Fluoroisatoic Anhydride, chemical formula C16H6F4N2O3, is a fluorescent dye. The following is an introduction to the nature, use, formulation and safety information of 3-Fluoroisatoic Anhydride:
Nature:
1. 3-Fluoroisatoic Anhydride is a red crystal, soluble in organic solvents such as ethanol, dimethylformamide, etc.
2. It has strong fluorescence emission and can produce red light in the visible light region.
3. 3-Fluoroisatoic Anhydride is relatively stable to air and light, but it is sensitive to strong acids and alkalis.
Use:
1. 3-Fluoroisatoic Anhydride is mainly used as fluorescent probe and fluorescent labeling agent.
2. It is often used in cell imaging, protein labeling and DNA/RNA detection in the biological field.
3. 3-Fluoroisatoic Anhydride can also be used to study fluorescence spectra, luminescence phenomena and photophysical chemistry.
Method:
The synthesis of 3-Fluoroisatoic Anhydride is usually carried out in the laboratory. A common preparation is synthesized by reacting 2,3,5,6-tetrafluoroisatin (C16H6F4N2O3) with an anhydride compound.
Safety Information:
The toxicity data of 1. 3-Fluoroisatoic Anhydride is limited, so it is necessary to pay attention to safety during use.
2. 3-Fluoroisatoic Anhydride may be irritating to eyes, skin and respiratory tract, so it is necessary to avoid inhalation and contact with eyes and skin.
3. During use and storage, appropriate protective measures should be taken, such as wearing gloves, safety glasses, etc., and ensure a well-ventilated environment.
Nature:
1. 3-Fluoroisatoic Anhydride is a red crystal, soluble in organic solvents such as ethanol, dimethylformamide, etc.
2. It has strong fluorescence emission and can produce red light in the visible light region.
3. 3-Fluoroisatoic Anhydride is relatively stable to air and light, but it is sensitive to strong acids and alkalis.
Use:
1. 3-Fluoroisatoic Anhydride is mainly used as fluorescent probe and fluorescent labeling agent.
2. It is often used in cell imaging, protein labeling and DNA/RNA detection in the biological field.
3. 3-Fluoroisatoic Anhydride can also be used to study fluorescence spectra, luminescence phenomena and photophysical chemistry.
Method:
The synthesis of 3-Fluoroisatoic Anhydride is usually carried out in the laboratory. A common preparation is synthesized by reacting 2,3,5,6-tetrafluoroisatin (C16H6F4N2O3) with an anhydride compound.
Safety Information:
The toxicity data of 1. 3-Fluoroisatoic Anhydride is limited, so it is necessary to pay attention to safety during use.
2. 3-Fluoroisatoic Anhydride may be irritating to eyes, skin and respiratory tract, so it is necessary to avoid inhalation and contact with eyes and skin.
3. During use and storage, appropriate protective measures should be taken, such as wearing gloves, safety glasses, etc., and ensure a well-ventilated environment.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: 3-FLUOROISATOIC ANHYDRIDE Visit Supplier Webpage Request for quotation
CAS: 174463-53-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 174463-53-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 3-FLUOROISATOIC ANHYDRIDE Visit Supplier Webpage Request for quotation
CAS: 174463-53-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 174463-53-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History