4-Chloro-α-methylbenzenemethanamine

4-Chloro-α-methylbenzenemethanamine - Names and Identifiers

Name	4-chloro-α-methylbenzylamine
Synonyms	549142_ALDRICH EINECS 228-576-0 1-(4-cholropheny)ethanamine p-chloro-α-phenylethylamine 1-(4-Chlorophenyl)ethylamine 1-(4-chlorophenyl)ethanamine 4-chloro-α-methylbenzylamine alpha-(p-Chlorophenyl)ethylamine (1S)-1-(4-chlorophenyl)ethanaminium 4-Chloro-α-methylbenzenemethanamine (1R)-1-(4-chlorophenyl)ethanaminium α-Methyl-4-chlorobenzenemethanamine alpha-Methyl-4-chlorobenzenemethanamine
CAS	6299-02-1
EINECS	228-576-0
InChI	InChI=1/C8H10ClN/c1-6(10)7-2-4-8(9)5-3-7/h2-6H,10H2,1H3/p+1/t6-/m1/s1

4-Chloro-α-methylbenzenemethanamine - Physico-chemical Properties

Molecular Formula	C8H10ClN
Molar Mass	155.62
Density	1.080 g/mL at 25 °C (lit.)
Melting Point	140-141 °C
Boling Point	82.4 °C (2.77537 mmHg)
Flash Point	217°F
Vapor Presure	0.0842mmHg at 25°C
Appearance	Liquid
Color	Clear yellow
pKa	8.82±0.10(Predicted)
Storage Condition	under inert gas (nitrogen or Argon) at 2–8 °C
Refractive Index	n20/D 1.543(lit.)
MDL	MFCD00044766

4-Chloro-α-methylbenzenemethanamine - Risk and Safety

Risk Codes	34 - Causes burns
Safety Description	S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.)
UN IDs	UN 2735 8/PG 3
WGK Germany	3
FLUKA BRAND F CODES	10-34
HS Code	29214900
Hazard Class	IRRITANT

4-Chloro-α-methylbenzenemethanamine - Introduction

It is an organic compound with the chemical formula C9H12ClN. Its main properties are as follows:

1. Appearance: White crystalline solid.
2. Solubility: It is soluble in most organic solvents, such as ethanol and chloroform, but its solubility in water is low.
3. Melting point: The melting point of is about 81-84 ℃, which has high thermal stability.

It has certain uses in the chemical and pharmaceutical fields, such:

1. drug synthesis: it can be used as an intermediate of organic synthesis for the synthesis of various drugs, such as antidepressants, sedatives, etc.
2. polymer materials: it can be used in the synthesis of polymers to prepare polymer materials with specific functions.

There are two general methods of preparation:

1. carbamate method: carbamate is reacted with 4-chlorophenyl ethanol to generate pyridine.
2. Alkylation reaction method: 4-chlorophenyl ethanol reacts with methylamine to generate phenol.

Regarding safety information, it is generally relatively safe under correct storage and operating conditions, but the following matters still need to be noted:

1. Avoid contact with skin and eyes: can cause irritation and burns.
2. avoid inhalation: a pungent smell, irritating effect on the respiratory tract.
3. storage precautions: store in a dry, cool, well-ventilated place, and away from fire and oxidant.

Follow laboratory safety procedures and wear personal protective equipment, such as lab gloves, goggles, and protective clothing, when using the glass. In case of accident or discomfort, seek medical help immediately.

Last Update：2024-04-09 20:02:46