Name | 5-methyl-5-propyl-1,3-dioxan-2-one |
Synonyms | Nsc 65885 Einecs 230-465-7 Carisoprodol iMpurity B Carisoprodol EP Impurity B 5-methyl-5-propyl-1,3-dioxan-2-one 5-Methyl-5-Propyl-2-methyl Dioxanone 1,3-Dioxan-2-one, 5-methyl-5-propyl- Carbonic acid 2-Methyl-2-propyltriMethylene ester Carbonic acid, cyclic 2-methyl-2-propyltrimethylene ester |
CAS | 7148-50-7 |
EINECS | 230-465-7 |
InChI | InChI=1/C8H14O3/c1-3-4-8(2)5-10-7(9)11-6-8/h3-6H2,1-2H3 |
Molecular Formula | C8H14O3 |
Molar Mass | 158.2 |
Density | 1.004±0.06 g/cm3(Predicted) |
Boling Point | 90-93°C@0.02mm |
Flash Point | 114.9°C |
Solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
Vapor Presure | 0.0108mmHg at 25°C |
Appearance | Solid |
Color | Colourless to Off-White Oil to Low Melting |
Storage Condition | 2-8°C |
Stability | Moisture Sensitive |
Refractive Index | 1.425 |
EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |