5-Amino-3-methylisothiazole hydrochloride
5-Amino-3-methylisothiazole hydrochloride
CAS: 52547-00-9
Molecular Formula: C4H7ClN2S
5-Amino-3-methylisothiazole hydrochloride - Names and Identifiers
| Name | 5-Amino-3-methylisothiazole hydrochloride |
| Synonyms | 3-methylisothiazol-5-amine HCl 3-methyl-1,2-thiazol-5-aminium chloride 5-amino-3-MethylisothozoleHydrochloride 5-AMINO-3-METHYLISOTHIAZOLE HYDROCHLORIDE 5-Amino-3-methylisothiazole hydrochloride 5-Amino-3-methyl-isothiazole hydrochloride 3-methyl-5-isothiazolaminmonohydrochloride 3-Methyl-1,2-thiazol-5-aMine hydrochloride 3-methylisothiazol-5-ylamine hydrochloride 5-Isothiazolamine, 3-methyl, monohydrochloride |
| CAS | 52547-00-9 |
| EINECS | 257-997-2 |
| InChI | InChI=1/C4H6N2S.ClH/c1-3-2-4(5)7-6-3;/h2H,5H2,1H3;1H |
| InChIKey | ZRTGHKVPFXNDHE-UHFFFAOYSA-N |
5-Amino-3-methylisothiazole hydrochloride - Physico-chemical Properties
| Molecular Formula | C4H7ClN2S |
| Molar Mass | 150.63 |
| Melting Point | 300°C(lit.) |
| Boling Point | 120.7°C at 760 mmHg |
| Flash Point | 26.8°C |
| Vapor Presure | 15mmHg at 25°C |
| BRN | 3689447 |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
5-Amino-3-methylisothiazole hydrochloride - Risk and Safety
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | NX8150300 |
| FLUKA BRAND F CODES | 10 |
5-Amino-3-methylisothiazole hydrochloride - Introduction
hydrochloride (hydrochloride) is an organic compound whose chemical formula is C4H7ClN2S. The following is a description of its nature, use, preparation and safety information:
Nature: hydrochloride is a white crystalline solid that can be dissolved in water, alcohol and some organic solvents.
2. it is a strong ammonia compounds.
3. Stable in the air, but will decompose under high temperature and bright light.
Use:
1. hydrochloride is often used as an intermediate for the synthesis of certain drugs in the pharmaceutical field.
2. It can also be used as an organic photosensitizer and dye synthesis.
Preparation Method:
The hydrochloride can be synthesized by the following steps:
1. methylisothiazolone and ammonia reaction to generate 5-amino -3-methyl-isothiazole.
2. react the resulting 5-amino -3-methyl-isothiazole with hydrochloric acid to generate hydrochloride.
Safety Information:
1. the hydrochloride may be irritating to the skin, eyes and mucous membranes. Avoid contact when using.
2. Wear appropriate protective gloves and glasses during operation.
3. Storage should avoid moisture and direct sunlight.
Nature: hydrochloride is a white crystalline solid that can be dissolved in water, alcohol and some organic solvents.
2. it is a strong ammonia compounds.
3. Stable in the air, but will decompose under high temperature and bright light.
Use:
1. hydrochloride is often used as an intermediate for the synthesis of certain drugs in the pharmaceutical field.
2. It can also be used as an organic photosensitizer and dye synthesis.
Preparation Method:
The hydrochloride can be synthesized by the following steps:
1. methylisothiazolone and ammonia reaction to generate 5-amino -3-methyl-isothiazole.
2. react the resulting 5-amino -3-methyl-isothiazole with hydrochloric acid to generate hydrochloride.
Safety Information:
1. the hydrochloride may be irritating to the skin, eyes and mucous membranes. Avoid contact when using.
2. Wear appropriate protective gloves and glasses during operation.
3. Storage should avoid moisture and direct sunlight.
Last Update：2024-04-09 02:00:46
