5-Oxopyrrolidine-3-carboxylic acid amide

5-Oxopyrrolidine-3-carboxylic acid amide - Names and Identifiers

Name	5-Oxopyrrolidine-3-carboxamide
Synonyms	Pyrrolidin-5-one-3-carboxamide 5-Oxopyrrolidine-3-carboxamide 3-pyrrolidinecarboxamide, 5-oxo- 3-Pyrrolidinecarboxamide, 5-oxo- 5-Oxo-1-pyrrolidine-3-carboxaMide 5-Oxopyrrolidine-3-Carboxamide(WXC03215) 5-Oxopyrrolidine-3-carboxylic acid amide Pyrrolidin-5-one-3-carboxylic acid amide 5-Oxo-pyrrolidine-3-carboxylic acid amide
CAS	14466-21-8
InChI	InChI=1S/C5H8N2O2/c6-5(9)3-1-4(8)7-2-3/h3H,1-2H2,(H2,6,9)(H,7,8)

5-Oxopyrrolidine-3-carboxylic acid amide - Physico-chemical Properties

Molecular Formula	C5H8N2O2
Molar Mass	128.13
Storage Condition	2-8°C
Sensitive	Irritant
MDL	MFCD03613706

5-Oxopyrrolidine-3-carboxylic acid amide - Risk and Safety

Hazard Class

IRRITANT

5-Oxopyrrolidine-3-carboxylic acid amide - Introduction

It is an organic compound with the formula C6H9NO2. The following is a description of its nature, use, preparation and safety information:

Nature:
1. Appearance: colorless to yellowish solid.
2. Melting Point: about 150-154 ℃.
3. Solubility: Soluble in most organic solvents, such as ethanol, methanol and dimethylformamide.

Use:
It has a wide range of applications in organic synthesis. It is often used as a reagent, ligand or intermediate. Its main applications include:
1. Reagent: As a reagent containing amide groups, it can participate in organic synthesis reactions, such as nucleophilic substitution reactions, Michael addition reactions, etc.
2. Ligand: in coordination chemistry, it can be used as a ligand to participate in the coordination reaction of metal ions.
3. Intermediate: As an intermediate compound, it can be used to synthesize other organic compounds.

Method:
Synthesized by a variety of methods, one of the commonly used methods is through the Wheeler reaction (Wittig reaction) synthesis. The process typically utilizes the reaction of a podophylotoxin and a methylcyclopropanone acetal to form the desired compound.

Safety Information:
1. The specific toxicity and danger of the pill have not been reported in detail. However, as organic compounds, they should be handled and stored in accordance with regular laboratory practices.
2. Avoid inhalation, contact with skin and eyes when handling and using the pill.
3. If you accidentally inhale or come into contact with the compound, you should immediately rinse the contaminated area with water and seek medical advice in time.
4. When storing, keep it in a dry and cool place, and keep away from flammable substances and oxidants.

Please note that the above information is for reference only. The specific operation and use should follow the laboratory safety operation specifications.

Last Update：2024-04-10 22:29:15