5-Thiazolecarboxylic acid, 2,3-dihydro-4-methyl-2-oxo- - Names and Identifiers
Name | 2-hydroxy-4-methylthiazole-5-carboxylic acid
|
Synonyms | 2-Hydroxy-4-methylthiazole-5-carboxylicacid 2-hydroxy-4-methylthiazole-5-carboxylic acid 4-methyl-2-oxo-3H-thiazole-5-carboxylic acid 2-Hydroxy-4-methyl-5-thiazolecarboxylic acid 2-keto-4-methyl-3H-thiazole-5-carboxylic acid 5-thiazolecarboxylic acid, 2-hydroxy-4-methyl- 4-methyl-2-oxo-3H-1,3-thiazole-5-carboxylic acid 2-Hydroxy-4-methyl-1,3-thiazole-5-carboxylic acid 2,3-Dihydro-4-Methyl-2-oxo-5-thiazolecarboxylic acid 5-Thiazolecarboxylic acid, 2,3-dihydro-4-methyl-2-oxo- 4-methyl-2-oxo-2,3-dihydro-1,3-thiazole-5-carboxylic acid
|
CAS | 875237-46-0
|
InChI | InChI=1/C5H5NO3S/c1-2-3(4(7)8)10-5(9)6-2/h1H3,(H,6,9)(H,7,8) |
5-Thiazolecarboxylic acid, 2,3-dihydro-4-methyl-2-oxo- - Physico-chemical Properties
Molecular Formula | C5H5NO3S
|
Molar Mass | 159.16 |
Density | 1.602g/cm3 |
Boling Point | 435.858°C at 760 mmHg |
Flash Point | 217.399°C |
Vapor Presure | 0mmHg at 25°C |
Storage Condition | 2-8℃ |
Refractive Index | 1.653 |
5-Thiazolecarboxylic acid, 2,3-dihydro-4-methyl-2-oxo- - Introduction
Acid is an organic compound with the chemical formula C6H6N2O3S. It has the following properties:
Nature:
1. Appearance: acid is a white crystalline solid.
2. solubility: soluble in water and some organic solvents, such as methanol and dimethyl sulfoxide.
3. Stability: relatively stable at room temperature.
Use:
azo acid is an important intermediate in organic synthesis. It can be used in the synthesis of other organic compounds, such as thiazolates and pesticides. In addition, it can also be used in cosmetics, food additives and dyes.
Preparation Method:
The preparation of acid is usually carried out by the following steps:
1.2-hydroxy -4-methyl thiazole is reacted with hydrochloric acid to generate 2-hydroxy -4-methyl thiazole hydrochloride.
2. React 2-hydroxy-4-methylthiazole hydrochloride with an oxidant (such as potassium permanganate) to oxidize it to acid.
Safety Information:
The toxicity of acid is low, but you should still pay attention to safety measures to avoid direct contact with the skin or inhalation of its dust. Wear appropriate protective equipment such as gloves and masks during use. In case of contact with eyes or skin, rinse immediately with plenty of water. Avoid contact with strong oxidants during storage, while keeping away from ignition and heat sources.
Last Update:2024-04-09 02:00:48