6-Mercapto-3-pyridine carboxlic acid
6-mercaptonicotinic acid
CAS: 17624-07-6;92823-43-3
Molecular Formula: C6H5NO2S
6-Mercapto-3-pyridine carboxlic acid - Names and Identifiers
| Name | 6-mercaptonicotinic acid |
| Synonyms | Einecs 241-599-0 TIMTEC-BB SBB004027 6-Mercaptonicotinic 6-mercaptonicotinic acid 1,6-dihydro-6-thioxonicotinic acid 6-mercapto-3-pyridinecarboxylic acid 6-Mercapto-3-pyridine carboxlic acid 1,6-Dihydro-6-thioxo-3-pyridinecarboxylic acid 6-thioxo-1,6-dihydropyridine-3-carboxylic acid |
| CAS | 17624-07-6 92823-43-3 |
| EINECS | 241-599-0 |
| InChI | InChI=1/C6H5NO2S/c8-6(9)4-1-2-5(10)7-3-4/h1-3H,(H,7,10)(H,8,9) |
6-Mercapto-3-pyridine carboxlic acid - Physico-chemical Properties
| Molecular Formula | C6H5NO2S |
| Molar Mass | 155.17 |
| Density | 1.49±0.1 g/cm3(Predicted) |
| Melting Point | 260-262°C (dec.)(lit.) |
| Boling Point | 259.9±50.0 °C(Predicted) |
| Flash Point | 111°C |
| Vapor Presure | 0.00377mmHg at 25°C |
| pKa | 5.88±0.20(Predicted) |
| Refractive Index | 1.694 |
6-Mercapto-3-pyridine carboxlic acid - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
