6-Methoxybenzo(b)thiophene
1-benzothiophen-6-yl methyl ether
CAS: 90560-10-4
Molecular Formula: C9H8OS
6-Methoxybenzo(b)thiophene - Names and Identifiers
| Name | 1-benzothiophen-6-yl methyl ether |
| Synonyms | 6-Methoxybenzothiophene 6-Methoxy-1-benzothiophen 6-Methoxybenzo(b)thiophene 6-methoxy-1-benzothiophene Benzo[b]thiophene, 6-Methoxy- 1-Benzothiophen-6-yl-methylether 1-benzothiophen-6-yl methyl ether |
| CAS | 90560-10-4 |
| InChI | InChI=1/C9H8OS/c1-10-8-3-2-7-4-5-11-9(7)6-8/h2-6H,1H3 |
6-Methoxybenzo(b)thiophene - Physico-chemical Properties
| Molecular Formula | C9H8OS |
| Molar Mass | 164.22 |
| Density | 1.198±0.06 g/cm3(Predicted) |
| Melting Point | 38-39 °C |
| Boling Point | 153-156 °C(Press: 16 Torr) |
| Flash Point | 116.411°C |
| Vapor Presure | 0.012mmHg at 25°C |
| Storage Condition | 2-8°C(protect from light) |
| Refractive Index | 1.637 |
| Use | This product is for scientific research only and shall not be used for other purposes. |
6-Methoxybenzo(b)thiophene - Introduction
1-benzothiophen-6-yl methyl ether is an organic compound with the molecular formula C9H8OS. The structure contains a benzene ring and a thiophene ring, and a methoxy group is attached to the benzene ring. Its nature is as follows:
1. Appearance: 1-benzothiophen-6-yl methyl ether is a white to light yellow solid.
2. Melting point: Melting point is about 60-62°C.
3. Solubility: It has good solubility in common organic solvents.
The uses of 1-benzothiophen-6-yl methyl ether mainly include the following aspects:
1. as an organic semiconductor material: due to its structure with thiophene ring and benzene ring, 1-benzothiophen-6-yl methyl ether can be used to prepare organic transport materials, such as organic transistors and organic light-emitting diodes (OLED) and other devices.
2. Chemical synthesis intermediate: It can be used as a starting material or intermediate for organic synthesis and used to prepare other organic compounds.
The preparation method of 1-benzothiophen-6-yl methyl ether can generally be carried out through the following steps:
1. First, benzothiophene is reacted with methyl iodide under alkaline conditions to generate 6-iodobenzothiophene.
2. then, 6-iodobenzothiophene is reacted with sodium methanol solution to generate 1-benzothiophen-6-yl methyl ether.
Regarding safety information, due to the limited information found, specific safety gender and hazard information cannot be provided. Therefore, when handling and using the compound, it is recommended to refer to a reliable chemical safety data sheet (MSDS) or other reliable chemical reference materials, and take necessary safety measures, such as wearing protective gloves, glasses and protective masks, and in a well-ventilated area. Operate in a well-ventilated area.
1. Appearance: 1-benzothiophen-6-yl methyl ether is a white to light yellow solid.
2. Melting point: Melting point is about 60-62°C.
3. Solubility: It has good solubility in common organic solvents.
The uses of 1-benzothiophen-6-yl methyl ether mainly include the following aspects:
1. as an organic semiconductor material: due to its structure with thiophene ring and benzene ring, 1-benzothiophen-6-yl methyl ether can be used to prepare organic transport materials, such as organic transistors and organic light-emitting diodes (OLED) and other devices.
2. Chemical synthesis intermediate: It can be used as a starting material or intermediate for organic synthesis and used to prepare other organic compounds.
The preparation method of 1-benzothiophen-6-yl methyl ether can generally be carried out through the following steps:
1. First, benzothiophene is reacted with methyl iodide under alkaline conditions to generate 6-iodobenzothiophene.
2. then, 6-iodobenzothiophene is reacted with sodium methanol solution to generate 1-benzothiophen-6-yl methyl ether.
Regarding safety information, due to the limited information found, specific safety gender and hazard information cannot be provided. Therefore, when handling and using the compound, it is recommended to refer to a reliable chemical safety data sheet (MSDS) or other reliable chemical reference materials, and take necessary safety measures, such as wearing protective gloves, glasses and protective masks, and in a well-ventilated area. Operate in a well-ventilated area.
Last Update：2024-04-10 22:29:15
Supplier List
Spot supply
Product Name: 1-benzothiophen-6-yl methyl ether Request for quotationCAS: 90560-10-4
Tel: +86-18162425036
Email: 3866263148@qq.com
Mobile: 18162425036
QQ: 3866263148
Wechat: 18162425036
Product Name: 1-benzothiophen-6-yl methyl ether Request for quotation
CAS: 90560-10-4
Tel: 17505222756
Email: pules.cn@gmail.com
Mobile: +86-17551318830
Wechat: 17505222756
CAS: 90560-10-4
Tel: 17505222756
Email: pules.cn@gmail.com
Mobile: +86-17551318830
Wechat: 17505222756
Product Name: Benzo[b]thiophene, 6-methoxy- Visit Supplier Webpage Request for quotation
CAS: 90560-10-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 90560-10-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: 1-benzothiophen-6-yl methyl ether Request for quotationCAS: 90560-10-4
Tel: +86-18162425036
Email: 3866263148@qq.com
Mobile: 18162425036
QQ: 3866263148
Wechat: 18162425036
Product Name: 1-benzothiophen-6-yl methyl ether Request for quotation
CAS: 90560-10-4
Tel: 17505222756
Email: pules.cn@gmail.com
Mobile: +86-17551318830
Wechat: 17505222756
CAS: 90560-10-4
Tel: 17505222756
Email: pules.cn@gmail.com
Mobile: +86-17551318830
Wechat: 17505222756
Product Name: Benzo[b]thiophene, 6-methoxy- Visit Supplier Webpage Request for quotation
CAS: 90560-10-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 90560-10-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History