62985-18-6
2-[(2-cyanoethyl)amino]benzoic acid
CAS: 62985-18-6
Molecular Formula: C10H10N2O2
62985-18-6 - Names and Identifiers
| Name | 2-[(2-cyanoethyl)amino]benzoic acid |
| Synonyms | N-(2-Cyanoethyl)anthanilic acid N-(2-CYANOETHYL)ANTHRANILIC ACID 2-[(2-cyanoethyl)amino]benzoic acid Benzoic acid, 2-[(2-cyanoethyl)amino]- Benzoic acid, 2-[(2-cyanoethyl)amino]- (9CI) |
| CAS | 62985-18-6 |
| InChI | InChI=1/C10H10N2O2/c11-6-3-7-12-9-5-2-1-4-8(9)10(13)14/h1-2,4-5,12H,3,7H2,(H,13,14) |
62985-18-6 - Physico-chemical Properties
| Molecular Formula | C10H10N2O2 |
| Molar Mass | 190.2 |
| Density | 1.286g/cm3 |
| Boling Point | 448.7°C at 760 mmHg |
| Flash Point | 225.2°C |
| Vapor Presure | 7.74E-09mmHg at 25°C |
| Refractive Index | 1.62 |
62985-18-6 - Introduction
2-[(2-cyanoethyl)amino]benzoic acid, also known as 2-[(2-cyanoethyl)amino]benzoic acid, is an organic compound. Its properties are as follows:
1. appearance: white crystalline or crystalline powder solid.
2. molecular formula: C12H12N2O2.
3. Molecular weight: 216.24g/mol.
4. solubility: difficult to dissolve in water, soluble in organic solvents such as ethanol and dichloromethane.
5. Melting point: about 160-163°C.
2-[(2-cyanoethyl)amino]benzoic acid has a wide range of uses in the fields of chemical research, pharmaceutical research and organic synthesis, including the following:
1. Drug intermediates: can be used as intermediates for some drugs, such as the synthesis of antiepileptic drugs and antihypertensive drugs.
2. organic synthesis reaction: can be used as a raw material or catalyst for organic synthesis reaction, participate in alkylation, acylation and carboxylation reaction.
3. chemical research: can be used in chemical research, such as analytical reagents and labeling reagents.
The method of preparing 2-[(2-cyanoethyl)amino]benzoic acid can be carried out by the following steps:
1. take 2-cyanoethylamine (2-cyanoethylamine) and benzoic acid amide reaction, generate 2-[(2-cyanoethyl)amino]benzamide (2-[(2-cyanoethyl)amino]benzamide).
2. hydrolyze the obtained 2-[(2-cyanoethyl)amino] benzamide under alkaline conditions to generate 2-[(2-cyanoethyl)amino]benzoic acid.
Regarding safety information, 2-[(2-cyanoethyl)amino]benzoic acid is relatively safe under normal use and storage conditions, but the following matters still need to be noted:
1. Avoid inhaling dust or contact with skin and eyes.
2. Wear personal protective equipment such as protective gloves, safety glasses and protective masks during operation.
3. Operate in a well-ventilated place to avoid dust and aerosols.
4. Store away from fire and oxidant.
In addition, for detailed information on the safe operation and storage of 2-[(2-cyanoethyl)amino]benzoic acid, refer to the Chemical Safety Technical Instructions and strictly follow the relevant regulations.
1. appearance: white crystalline or crystalline powder solid.
2. molecular formula: C12H12N2O2.
3. Molecular weight: 216.24g/mol.
4. solubility: difficult to dissolve in water, soluble in organic solvents such as ethanol and dichloromethane.
5. Melting point: about 160-163°C.
2-[(2-cyanoethyl)amino]benzoic acid has a wide range of uses in the fields of chemical research, pharmaceutical research and organic synthesis, including the following:
1. Drug intermediates: can be used as intermediates for some drugs, such as the synthesis of antiepileptic drugs and antihypertensive drugs.
2. organic synthesis reaction: can be used as a raw material or catalyst for organic synthesis reaction, participate in alkylation, acylation and carboxylation reaction.
3. chemical research: can be used in chemical research, such as analytical reagents and labeling reagents.
The method of preparing 2-[(2-cyanoethyl)amino]benzoic acid can be carried out by the following steps:
1. take 2-cyanoethylamine (2-cyanoethylamine) and benzoic acid amide reaction, generate 2-[(2-cyanoethyl)amino]benzamide (2-[(2-cyanoethyl)amino]benzamide).
2. hydrolyze the obtained 2-[(2-cyanoethyl)amino] benzamide under alkaline conditions to generate 2-[(2-cyanoethyl)amino]benzoic acid.
Regarding safety information, 2-[(2-cyanoethyl)amino]benzoic acid is relatively safe under normal use and storage conditions, but the following matters still need to be noted:
1. Avoid inhaling dust or contact with skin and eyes.
2. Wear personal protective equipment such as protective gloves, safety glasses and protective masks during operation.
3. Operate in a well-ventilated place to avoid dust and aerosols.
4. Store away from fire and oxidant.
In addition, for detailed information on the safe operation and storage of 2-[(2-cyanoethyl)amino]benzoic acid, refer to the Chemical Safety Technical Instructions and strictly follow the relevant regulations.
Last Update：2024-04-09 20:52:54
