870703-84-7
(5-fluoro-2-sulfanyl-phenyl)methanol
CAS: 870703-84-7
Molecular Formula: C7H7FOS
870703-84-7 - Names and Identifiers
| Name | (5-fluoro-2-sulfanyl-phenyl)methanol |
| CAS | 870703-84-7 |
| InChI | InChI=1/C7H7FOS/c8-6-1-2-7(10)5(3-6)4-9/h1-3,9-10H,4H2 |
870703-84-7 - Physico-chemical Properties
| Molecular Formula | C7H7FOS |
| Molar Mass | 158.19 |
| Density | 1.317g/cm3 |
| Melting Point | 60-64 °C (lit.) |
| Boling Point | 267.404°C at 760 mmHg |
| Flash Point | 115.522°C |
| Vapor Presure | 0.004mmHg at 25°C |
| Storage Condition | 2-8°C |
| Refractive Index | 1.596 |
870703-84-7 - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | UN 3335 |
| WGK Germany | 3 |
870703-84-7 - Introduction
(g) methanol is an organic compound with a molecular formula of C7H7FOHS and a molecular weight of 156.19g/mol. The compound has the following properties:
1. Appearance: colorless to light yellow liquid;
2. Solubility: Soluble in organic solvents such as ethanol, dimethylformamide and tetrahydrofuran;
3. melting point: about 18 ℃.
methanol is often used in organic synthesis as an important starting material or intermediate. Its specific application areas include:
1. pharmaceutical chemistry: used as a synthetic drug intermediates, can be used for the synthesis of antiviral drugs, anti-tumor drugs, etc;
2. agricultural chemistry: used as synthetic plant growth regulators, pesticides and other pesticides;
3. cosmetics: can be used for synthetic spices and preservatives.
The method of preparing (calcium methanol) can be carried out by the following steps:
1. reacting styrene with hydrogen fluoride in the presence of a cyanamide surfactant (such as sodium bicarbonate) to obtain 5-fluoro-styrene;
2. reacting 5-fluoro-styrene with mercaptan to obtain 5-fluoro -2-mercapto styrene; Br> 3. Condense 5-fluoro-2-mercaptostyrene with formaldehyde in the presence of alkali to obtain (fluorene) methanol.
Regarding safety information, (a) methanol is an organic compound and may be dangerous. When using and storing, the following recommendations should be followed:
1. Avoid contact with skin, eyes and respiratory tract, and wear appropriate personal protective equipment, such as gloves, goggles and protective masks;
2. Use in a well-ventilated place to avoid inhaling its vapor;
3. When storing, it should be kept in a sealed container, away from fire and high temperature areas;
4. please follow the relevant regulations and safety procedures.
In practical applications, the safety operation guidelines for related chemicals should be strictly observed, and professionals should be consulted when needed.
1. Appearance: colorless to light yellow liquid;
2. Solubility: Soluble in organic solvents such as ethanol, dimethylformamide and tetrahydrofuran;
3. melting point: about 18 ℃.
methanol is often used in organic synthesis as an important starting material or intermediate. Its specific application areas include:
1. pharmaceutical chemistry: used as a synthetic drug intermediates, can be used for the synthesis of antiviral drugs, anti-tumor drugs, etc;
2. agricultural chemistry: used as synthetic plant growth regulators, pesticides and other pesticides;
3. cosmetics: can be used for synthetic spices and preservatives.
The method of preparing (calcium methanol) can be carried out by the following steps:
1. reacting styrene with hydrogen fluoride in the presence of a cyanamide surfactant (such as sodium bicarbonate) to obtain 5-fluoro-styrene;
2. reacting 5-fluoro-styrene with mercaptan to obtain 5-fluoro -2-mercapto styrene; Br> 3. Condense 5-fluoro-2-mercaptostyrene with formaldehyde in the presence of alkali to obtain (fluorene) methanol.
Regarding safety information, (a) methanol is an organic compound and may be dangerous. When using and storing, the following recommendations should be followed:
1. Avoid contact with skin, eyes and respiratory tract, and wear appropriate personal protective equipment, such as gloves, goggles and protective masks;
2. Use in a well-ventilated place to avoid inhaling its vapor;
3. When storing, it should be kept in a sealed container, away from fire and high temperature areas;
4. please follow the relevant regulations and safety procedures.
In practical applications, the safety operation guidelines for related chemicals should be strictly observed, and professionals should be consulted when needed.
Last Update：2024-04-09 20:02:46
