ASINEX-REAG BAS 02752250
2-chloro-N-methyl-N-phenylacetamide
CAS: 2620-05-5
Molecular Formula: C9H10ClNO
ASINEX-REAG BAS 02752250 - Names and Identifiers
| Name | 2-chloro-N-methyl-N-phenylacetamide |
| Synonyms | TIMTEC-BB SBB010703 ASINEX-REAG BAS 02752250 N-Methyl-α-chloroacetoanilide 2-CHLORO-N-METHYL-N-PHENYLACETAMIDE 2-chloro-N-methyl-N-phenylacetamide N-Methyl-N-phenyl-2-chloroacetamide 2-chloro-N-methyl-N-phenyl-ethanamide 2-CHLORO-N-METHYL-4-N-PHENYL-ACETAMIDE N-(Chloroacetyl)-N-methylaniline, N-(Chloroacetyl)-N-phenylmethylamine |
| CAS | 2620-05-5 |
| EINECS | 220-053-5 |
| InChI | InChI=1/C9H10ClNO/c1-11(9(12)7-10)8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
ASINEX-REAG BAS 02752250 - Physico-chemical Properties
| Molecular Formula | C9H10ClNO |
| Molar Mass | 183.63 |
| Density | 1.204±0.06 g/cm3(Predicted) |
| Melting Point | 74-77°C |
| Boling Point | 126-132 °C(Press: 6 Torr) |
| Flash Point | 113.1°C |
| Vapor Presure | 0.0104mmHg at 25°C |
| pKa | 0.36±0.50(Predicted) |
| Refractive Index | 1.57 |
ASINEX-REAG BAS 02752250 - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Hazard Class | IRRITANT |
ASINEX-REAG BAS 02752250 - Introduction
It is an organic compound with the chemical formula C9H10ClNO. The following is a description of its nature, use, preparation and safety information:
Nature:
-Appearance: White crystalline powder.
-Solubility: Its solubility in water is low, but it is soluble in most organic solvents.
Use:
-It is often used as a pharmaceutical intermediate, especially an intermediate for the synthesis of antibacterial drugs, such as cephalosporins.
Method:
-and can be prepared by the following steps:
1. Dissolve benzoyl chloride in an organic solvent.
2. Add methylamine and stir the reaction.
3. Add cuprous chloride as a catalyst, and continue to stir the reaction.
4. Crystallize after cooling to obtain.
Safety Information:
-It has a certain degree of toxicity, so you need to pay attention to safety during use and storage.
-It may be irritating to the eyes, skin and respiratory tract, so wear appropriate protective equipment when exposed.
-Avoid inhaling dust or contact with skin during operation.
-If accidentally inhaled or ingested, seek medical attention immediately and show the compound's safety data sheet to the doctor for reference.
Nature:
-Appearance: White crystalline powder.
-Solubility: Its solubility in water is low, but it is soluble in most organic solvents.
Use:
-It is often used as a pharmaceutical intermediate, especially an intermediate for the synthesis of antibacterial drugs, such as cephalosporins.
Method:
-and can be prepared by the following steps:
1. Dissolve benzoyl chloride in an organic solvent.
2. Add methylamine and stir the reaction.
3. Add cuprous chloride as a catalyst, and continue to stir the reaction.
4. Crystallize after cooling to obtain.
Safety Information:
-It has a certain degree of toxicity, so you need to pay attention to safety during use and storage.
-It may be irritating to the eyes, skin and respiratory tract, so wear appropriate protective equipment when exposed.
-Avoid inhaling dust or contact with skin during operation.
-If accidentally inhaled or ingested, seek medical attention immediately and show the compound's safety data sheet to the doctor for reference.
Last Update：2024-04-09 20:49:11
