BHECNPOVJVTHKS-UHFFFAOYSA-N

BHECNPOVJVTHKS-UHFFFAOYSA-N - Names and Identifiers

Name	Cycloundecanecarboxylic acid
Synonyms	BHECNPOVJVTHKS-UHFFFAOYSA-N Cycloundecanecarboxylic acid CYCLOUNDECANECARBOXYLIC ACID
CAS	831-67-4
EINECS	212-609-0
InChI	InChI=1/C12H22O2/c13-12(14)11-9-7-5-3-1-2-4-6-8-10-11/h11H,1-10H2,(H,13,14)

BHECNPOVJVTHKS-UHFFFAOYSA-N - Physico-chemical Properties

Molecular Formula	C12H22O2
Molar Mass	198.3
Density	0.956g/cm³
Boling Point	325.4°C at 760 mmHg
Flash Point	155.5°C
Vapor Presure	4.65E-05mmHg at 25°C
Refractive Index	1.46

BHECNPOVJVTHKS-UHFFFAOYSA-N - Introduction

Cycloundecanecarboxylic acid(Cycloundecanecarboxylic acid) is an organic compound with a chemical formula of C11H20O2 and a molecular weight of 184.28g/mol. It is a spirocycloalkane carboxylic acid having an eleven-membered ring and a carboxyl group.

Cycloundecanecarboxylic acid is common in laboratory studies and its properties are as follows:
1. Appearance and state: Cycloundecanecarboxylic acid is colorless to white crystal or powder;
2. melting point: the melting point of Cycloundecanecarboxylic acid is about 63-65 ℃;
3. solubility: Cycloundecanecarboxylic acid soluble in alcohol, ether, ester and other organic solvents, insoluble in water.

The main uses of Cycloundecanecarboxylic acid include:
1. Laboratory research: as an intermediate or catalyst in organic synthesis;
2. surfactant: can be used to prepare compounds with surface active properties;
3. polymer materials: can be applied to the synthesis process of some polymers.

Preparation of Cycloundecanecarboxylic acid:
Cycloundecanecarboxylic acid can be obtained by a series of reactions such as oxidation, acidolysis and dehydration of cyclohexanol. The specific method can be adjusted and optimized according to actual needs and conditions.

Regarding the security information of Cycloundecanecarboxylic acid, you need to pay attention to the following points:
1. Cycloundecanecarboxylic acid is irritating to eyes, skin and respiratory tract;
2. in the process of operation, attention should be paid to avoid contact with skin, eyes and inhalation;
3. in the use and storage of Cycloundecanecarboxylic acid need to take appropriate personal protective measures, such as wearing protective glasses, masks, gloves, etc;
4. If discomfort occurs after contact or inhalation of Cycloundecanecarboxylic acid, immediately stop exposure, wash the affected area, and seek medical help.

Although Cycloundecanecarboxylic acid is widely used in laboratories, it is still necessary to comply with relevant safety procedures and guidelines when using and handling it to ensure personal safety and the safety of the laboratory environment.

Last Update：2024-04-10 22:29:15