Benzene, 1,5-dibromo-3-fluoro-2-isocyanato-
1,5-dibromo-3-fluoro-2-isocyanatobenzene
CAS: 302912-27-2
Molecular Formula: C7H2Br2FNO
Benzene, 1,5-dibromo-3-fluoro-2-isocyanato- - Names and Identifiers
| Name | 1,5-dibromo-3-fluoro-2-isocyanatobenzene |
| Synonyms | 1,5-dibromo-3-fluoro-2-isocyanatobenzene Benzene, 1,5-dibromo-3-fluoro-2-isocyanato- |
| CAS | 302912-27-2 |
| InChI | InChI=1/C7H2Br2FNO/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-2H |
Benzene, 1,5-dibromo-3-fluoro-2-isocyanato- - Physico-chemical Properties
| Molecular Formula | C7H2Br2FNO |
| Molar Mass | 294.9 |
| Density | 2.01g/cm3 |
| Melting Point | 43-47°C(lit.) |
| Boling Point | 291.3°C at 760 mmHg |
| Flash Point | >230°F |
| Vapor Presure | 0.00197mmHg at 25°C |
| Refractive Index | 1.614 |
Benzene, 1,5-dibromo-3-fluoro-2-isocyanato- - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
Benzene, 1,5-dibromo-3-fluoro-2-isocyanato- - Introduction
1, is an organic compound with the chemical formula C7H2Br2FNO. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Appearance: 1. It is a colorless to light yellow solid, usually in the form of crystal or crystal powder.
2. Melting point: Its melting point range is 70-75 degrees Celsius.
3. Solubility: It is soluble in organic solvents such as ether and dimethylformamide.
Use:
1. Chemical raw materials: 1. It can be used as an intermediate in organic synthesis and used to synthesize other organic compounds.
2. Pesticide ingredients: It can also be used as one of the ingredients of certain pesticides to prevent and control crop diseases and insect pests.
Method:
1, the synthesis of Ni can be carried out through the following steps:
1. First, ammonium sulfite was added to 2,4-dibromo-6-fluorobenzaldehyde as a substrate, followed by heating.
2. After reduction reaction, 2,4-dibromo-6-fluorophenylmethanol is generated.
3. To 2,4-dibromo-6-fluorophenylmethanol, phosphorus trichloride and phenyl isocyanate were added to carry out the reaction.
4. Purify by distillation and crystallization to obtain the target product 1.
Safety Information:
For organic compound 1, note the following safety information:
1. Toxicity: it may be toxic to the human body, irritating and dangerous.
2. Protective measures: when handling, need to wear personal protective equipment, such as gloves, protective glasses and protective mask.
3. Storage: It should be stored in a cool, dry, well-ventilated place, away from combustibles and oxidants.
4. Waste disposal: Waste shall be properly disposed of in accordance with local regulations and shall not be dumped.
Nature:
1. Appearance: 1. It is a colorless to light yellow solid, usually in the form of crystal or crystal powder.
2. Melting point: Its melting point range is 70-75 degrees Celsius.
3. Solubility: It is soluble in organic solvents such as ether and dimethylformamide.
Use:
1. Chemical raw materials: 1. It can be used as an intermediate in organic synthesis and used to synthesize other organic compounds.
2. Pesticide ingredients: It can also be used as one of the ingredients of certain pesticides to prevent and control crop diseases and insect pests.
Method:
1, the synthesis of Ni can be carried out through the following steps:
1. First, ammonium sulfite was added to 2,4-dibromo-6-fluorobenzaldehyde as a substrate, followed by heating.
2. After reduction reaction, 2,4-dibromo-6-fluorophenylmethanol is generated.
3. To 2,4-dibromo-6-fluorophenylmethanol, phosphorus trichloride and phenyl isocyanate were added to carry out the reaction.
4. Purify by distillation and crystallization to obtain the target product 1.
Safety Information:
For organic compound 1, note the following safety information:
1. Toxicity: it may be toxic to the human body, irritating and dangerous.
2. Protective measures: when handling, need to wear personal protective equipment, such as gloves, protective glasses and protective mask.
3. Storage: It should be stored in a cool, dry, well-ventilated place, away from combustibles and oxidants.
4. Waste disposal: Waste shall be properly disposed of in accordance with local regulations and shall not be dumped.
Last Update：2024-04-10 22:29:15
