Benzene, 2-broMo-1-chloro-3,5-difluoro-

Benzene, 2-broMo-1-chloro-3,5-difluoro- - Names and Identifiers

Name	2-Bromo-1-chloro-3,5-difluorobenzene
Synonyms	2-chloro-4,6-difluorobromobenzene 1-Bromo-2-chloro-4,6-diflorobenzene 1-Bromo-2-chloro-4,6-difluorobenzene 2-Bromo-1-chloro-3,5-difluorobenzene Benzene, 2-broMo-1-chloro-3,5-difluoro-
CAS	1020198-58-6
InChI	InChI=1S/C6H2BrClF2/c7-6-4(8)1-3(9)2-5(6)10/h1-2H

Benzene, 2-broMo-1-chloro-3,5-difluoro- - Physico-chemical Properties

Molecular Formula	C6H2BrClF2
Molar Mass	227.43
Density	1.805±0.06 g/cm3(Predicted)
Boling Point	184.0±35.0 °C(Predicted)
Storage Condition	Sealed in dry,Room Temperature

Benzene, 2-broMo-1-chloro-3,5-difluoro- - Introduction

1-Bromo-2-chloro-4, 6-difluorobenzene, chemical formula C6H2BrClF2, is an organic compound containing bromine, chlorine and fluorine. Its properties are as follows:

1. Appearance: colorless to light yellow liquid or crystalline solid;
2. Solubility: Soluble in organic solvents such as ethanol, acetone and ether solvents;
3. melting point: about 85-87 ˚C;
4. boiling point: about 190-200 ˚C;
5. density: about 1.86 g/cm.

1-Bromo-2-chloro-4, 6-difluorobenzene is mainly used as an intermediate in organic synthesis, and its uses include:

1. Pesticide manufacturing: can be used as the starting material for the manufacture of heterocycloic and aromatic pesticides;
2. pharmaceutical synthesis: can be used for the synthesis of drugs and pharmaceutical intermediates;
3. material science: can be used for the preparation of polymer materials and coatings.

In terms of preparation, 1-bromo-2-chloro-4, 6-difluorobenzene can be prepared by the following steps:

1. First, 1-bromo -4, 6-difluorobenzene is reacted with stannous bromide to obtain 1,4-difluorobenzene;
2. Then, 1,4-difluorobenzene is reacted with hydrogen chloride to obtain 1-bromo-2-chloro-4, 6-difluorobenzene.

In terms of safety information, 1-bromo-2-chloro-4, 6-difluorobenzene is a dangerous product with irritating and harmful properties to the eyes, skin and respiratory system. In the use and storage should pay attention to the following matters:

1. contact should wear appropriate protective equipment, such as gloves, protective glasses and protective clothing;
2. Avoid inhaling its vapor or dust, and use it in a well-ventilated place;
3. in case of contact with skin or eyes, rinse immediately with water and seek medical help;
4. When storing, it should be placed in a sealed container, away from fire and oxidizing agents.

Last Update：2024-04-09 21:50:46