Benzoic acid, 5-amino-2,4-difluoro-, methyl ester (9CI) - Names and Identifiers
Name | Methyl 5-amino-2,4-difluorobenzoate
|
Synonyms | Methyl 5-amino-2,4-difluorobenzoate Benzoic acid, 5-amino-2,4-difluoro-, methyl ester Benzoic acid, 5-amino-2,4-difluoro-, methyl ester (9CI)
|
CAS | 125568-73-2
|
InChI | InChI=1/C8H7F2NO2/c1-13-8(12)4-2-7(11)6(10)3-5(4)9/h2-3H,11H2,1H3 |
Benzoic acid, 5-amino-2,4-difluoro-, methyl ester (9CI) - Physico-chemical Properties
Molecular Formula | C8H7F2NO2
|
Molar Mass | 187.14 |
Density | 1.356g/cm3 |
Boling Point | 284.049°C at 760 mmHg |
Flash Point | 125.589°C |
Vapor Presure | 0.003mmHg at 25°C |
Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
Refractive Index | 1.524 |
MDL | MFCD09396710 |
Benzoic acid, 5-amino-2,4-difluoro-, methyl ester (9CI) - Introduction
Methyl 5-amino -2, 4-difluorobenzoate is an organic compound with the following properties:
1. Appearance: colorless liquid
2. molecular formula: C8H6F2NO2
3. Molecular weight: 191.14g/mol
4. melting point:-3 ℃
5. Boiling point: 105-107 ℃
6. Solubility: Soluble in organic solvents, such as ether and methanol.
The main uses of methyl 5-amino -2, 4-difluorobenzoate include the following:
1. medicinal chemistry: in the pharmaceutical industry, it can be used as a substrate for the preparation of certain drugs.
2. Agriculture: As a pesticide intermediate, it can be used to synthesize certain pesticides and herbicides.
3. Chemical research: As an important reagent in organic synthesis, it is used to construct fluorine-containing organic molecules.
A common method for preparing methyl 5-amino -2, 4-difluorobenzoate is to replace the fluorine atom in the molecule with an amino group by reacting methyl benzoate with hydrogen fluoride in a reactor and then adding ammonia to the reaction.
The compound has the following safety information:
1. toxicity: 5-amino -2,4-difluorobenzoate methyl ester has certain toxicity, should avoid inhalation, intake or contact with skin and eyes.
2. Combustibility: Combustible under open flame, decomposition and dangerous reactions will occur when encountering high temperature.
3. storage: should be stored in a cool, ventilated place, away from fire and organic matter.
4. Waste disposal: It should be disposed in accordance with local regulations to avoid environmental pollution.
In order to ensure safe use, please read the safety data form of the compound carefully before use and follow correct operation and protective measures.
Last Update:2024-04-10 22:41:03