Benzopyrazine-6-boronic acid Hydrochloride

Benzopyrazine-6-boronic acid Hydrochloride - Names and Identifiers

Name	Quinoxalin-6-ylboronic acid hydrochloride (1:1)
Synonyms	QUINOXALIN-6-YLBORONIC ACID 6-QUINOXALINYL-BORONIC ACID BENZOPYRAZINE-6-BORONIC ACID HCL Quinoxalin-6-ylboronic acid hydrochloride Benzopyrazine-6-boronic acid Hydrochloride Benzopyrazin-6-ylboronic acid hydrochloride (6-benzylpyrazin-2-yl)boronic acid hydrochloride
CAS	852362-25-5
InChI	InChI=1/C8H7BN2O2.ClH/c12-9(13)6-1-2-7-8(5-6)11-4-3-10-7;/h1-5,12-13H;1H

Benzopyrazine-6-boronic acid Hydrochloride - Physico-chemical Properties

Molecular Formula	C8H8BClN2O2
Molar Mass	210.43
Storage Condition	under inert gas (nitrogen or Argon) at 2-8°C

Benzopyrazine-6-boronic acid Hydrochloride - Risk and Safety

Hazard Symbols	Xi - Irritant
Risk Codes	R37/38 - Irritating to respiratory system and skin. R41 - Risk of serious damage to eyes
Safety Description	S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S39 - Wear eye / face protection.

Benzopyrazine-6-boronic acid Hydrochloride - Introduction

Quinoxalin-6-ylboronic acid hydrochloride (1:1) is an organic compound with the chemical formula C8H7BClN2O. Its properties are as follows:

1. appearance: white or white crystal powder.

2. solubility: soluble in water and some organic solvents, such as alcohol, ether and dimethyl sulfoxide.

3. Stability: Stable under dry conditions, but avoid contact with moisture in the air.

The main uses of Quinoxalin-6-ylboronic acid hydrochloride (1:1) include:

1. Organic synthesis: It can be used as a boric acid reagent in organic synthesis to construct carbon-carbon bonds and carbon-boron bonds. It can undergo substitution reactions, nucleophilic addition reactions, coupling reactions, etc. with substrates.

2. Pharmaceutical field: The compound can be used as a pharmaceutical intermediate to synthesize compounds with biological activity.

3. Catalyst: It can be used as a ligand of the catalyst to participate in metal-catalyzed reactions.

The preparation of this compound is generally synthesized by chemical synthesis, and the specific steps can be:

1. Dissolve an appropriate amount of benzopyrazine and boric acid in an appropriate amount of organic solvent.

2. Under appropriate temperature and reaction time, prepare the acid salt form by adding an acidic solution.

3. Separate and collect the product by centrifugation or filtration.

Safety Information:

1. Effects on human body: Quinoxalin-6-ylboronic acid hydrochloride (1:1) may have irritating effects on skin, eyes and respiratory tract. Avoid direct skin contact and ensure good ventilation.

2. storage precautions: it should be stored in a dry, dark and airtight container, away from combustibles and oxidants. Avoid contact with moisture.

3. Waste disposal: Follow local regulations to properly classify and dispose of waste and avoid environmental pollution.

Last Update：2024-04-09 18:58:34