Butyryl bromide
Butyryl bromide
CAS: 5856-82-6
Molecular Formula: C4H7BrO
Butyryl bromide - Names and Identifiers
| Name | Butyryl bromide |
| Synonyms | butanoylbromide Butyryl bromide BUTYRYL BROMIDE |
| CAS | 5856-82-6 |
| InChI | InChI=1/C4H7BrO/c1-2-3-4(5)6/h2-3H2,1H3 |
Butyryl bromide - Physico-chemical Properties
| Molecular Formula | C4H7BrO |
| Molar Mass | 151 |
| Density | 1.4162 |
| Boling Point | 129°C (rough estimate) |
| Flash Point | 54.868°C |
| Vapor Presure | 10.3mmHg at 25°C |
| Refractive Index | 1.5960 |
Butyryl bromide - Introduction
Butyryl bromide(Butyryl bromide) is an organic compound with a chemical formula of C4H7BrO and a colorless liquid in appearance. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Butyryl bromide has a high density of 1.378 g/mL.
2. at room temperature, Butyryl bromide can be vaporized, with pungent odor.
3. It is insoluble in water, but soluble in organic solvents such as ether and benzene.
Use:
1. Butyryl bromide is often used as an important intermediate in organic synthesis. It can be used in the preparation of other organic compounds, such as pharmaceuticals, pesticides and dyes.
2. Butyryl bromide can also be used as reagents for the identification and analysis of some compounds.
Preparation Method:
Butyryl bromide can be prepared by reacting butyric acid and sulfoxide bromide. Specific steps are:
1. Add butyric acid slowly dropwise to ice-cold sulfoxide bromide (SOBr2).
2. Stir the reaction mixture at room temperature until the reaction is complete.
3. Filter the mixture and separate the product Butyryl bromide from the solvent.
Safety Information:
1. Butyryl bromide is an organic halide with certain toxicity. Please pay attention to safety measures during operation, such as wearing chemical protective gloves and goggles.
2. avoid contact with skin and eyes, so as not to cause irritation and damage.
3. When using or storing Butyryl bromide, please ensure a well-ventilated place to prevent the accumulation of vapor.
4. Do not store Butyryl bromide with strong oxidants, oxidizing substances or combustibles to avoid the risk of fire or explosion.
5. If you accidentally inhale or ingest Butyryl bromide, seek medical attention and provide chemical information to your doctor immediately.
Nature:
1. Butyryl bromide has a high density of 1.378 g/mL.
2. at room temperature, Butyryl bromide can be vaporized, with pungent odor.
3. It is insoluble in water, but soluble in organic solvents such as ether and benzene.
Use:
1. Butyryl bromide is often used as an important intermediate in organic synthesis. It can be used in the preparation of other organic compounds, such as pharmaceuticals, pesticides and dyes.
2. Butyryl bromide can also be used as reagents for the identification and analysis of some compounds.
Preparation Method:
Butyryl bromide can be prepared by reacting butyric acid and sulfoxide bromide. Specific steps are:
1. Add butyric acid slowly dropwise to ice-cold sulfoxide bromide (SOBr2).
2. Stir the reaction mixture at room temperature until the reaction is complete.
3. Filter the mixture and separate the product Butyryl bromide from the solvent.
Safety Information:
1. Butyryl bromide is an organic halide with certain toxicity. Please pay attention to safety measures during operation, such as wearing chemical protective gloves and goggles.
2. avoid contact with skin and eyes, so as not to cause irritation and damage.
3. When using or storing Butyryl bromide, please ensure a well-ventilated place to prevent the accumulation of vapor.
4. Do not store Butyryl bromide with strong oxidants, oxidizing substances or combustibles to avoid the risk of fire or explosion.
5. If you accidentally inhale or ingest Butyryl bromide, seek medical attention and provide chemical information to your doctor immediately.
Last Update：2024-04-09 02:00:47
Supplier List
Product Name: Sodium Phenylbutyrate Impurity 11 Request for quotation
CAS: 5856-82-6
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
CAS: 5856-82-6
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
Product Name: Sodium Phenylbutyrate Impurity 11 Request for quotation
CAS: 5856-82-6
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
CAS: 5856-82-6
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
View History