Name | cucurbit(7)uril |
Synonyms | Curcubit[7]uril cucurbit(7)uril Cucurbit[7]uril Cucurbit[7]uril hydrate Cucurbit[7]uril,research use Cucurbit[7]uril hydrate contains acid of crystalization |
CAS | 259886-50-5 |
InChI | InChI=1S/C42H42N28O14/c71-29-43-1-44-16-18-48(30(44)72)4-52-20-22-56(34(52)76)8-60-24-26-64(38(60)80)12-68-28-27-67(41(68)83)11-63-25-23-59(37(63)79)7-55-21-19-51(33(55)75)3-47(29)17-15(43)45-2-46(16)32(74)50(18)6-54(20)36(78)58(22)10-62(24)40(82)66(26)14-70(28)42(84)69(27)13-65(25)39(81)61(23)9-57(21)35(77)53(19)5-49(17)31(45)73/h15-28H,1-14H2 |
Molecular Formula | C42H42N28O14 |
Molar Mass | 1162.96 |
Density | 2.69 |
Solubility | Pure water is almost insoluble. It is soluble in inorganic salt water (concentration about 0.1M) solution or strong acid, such as hydrochloric acid and sulfuric acid above 20%. The process is relatively slow. It can be heated at 50 ℃ and dissolved faster. If it forms molecules with other organic substances, it will not dissolve. |
Appearance | solid |
Color | white |
pKa | 0.09±0.20(Predicted) |
Storage Condition | Room Temprature |
WGK Germany | 3 |