Cbz-D-Prolinol
benzyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate
CAS: 72597-18-3
Molecular Formula: C13H17NO3
Cbz-D-Prolinol - Names and Identifiers
| Name | benzyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| Synonyms | Cbz-D-Prolinol Z-D-PROLINOL, 97 N-Cbz-D-Prolinol Z-D-Prolinol, 97 L-CBZ--D-PROLINOL (R)-N-Cbz-prolinol -Benzyl 2-(hydroxymethyl) N-Carbonylbenzyloxy-D-prolinol (R)-benzyl 2-(hydroxymethyl)pyrrolidine-1-carboxylate benzyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| CAS | 72597-18-3 |
| InChI | InChI=1/C13H17NO3/c15-9-12-7-4-8-14(12)13(16)17-10-11-5-2-1-3-6-11/h1-3,5-6,12,15H,4,7-10H2/t12-/m1/s1 |
Cbz-D-Prolinol - Physico-chemical Properties
| Molecular Formula | C13H17NO3 |
| Molar Mass | 235.28 |
| Density | 1.135g/mLat 25°C |
| Boling Point | 382.0±25.0 °C(Predicted) |
| Flash Point | >230°F |
| Vapor Presure | 1.62E-06mmHg at 25°C |
| pKa | 14.77±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | n 20/D 1.5396 |
Cbz-D-Prolinol - Risk and Safety
| Hazard Symbols | T - Toxic |
| Risk Codes | R25 - Toxic if swallowed R36 - Irritating to the eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 29339900 |
Cbz-D-Prolinol - Introduction
Benzyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate is a compound whose chemical name is benzyl (2R)-2-(hydroxymethyl)pyrrolidine-l-carboxylate. The following is an introduction to some of its properties, uses, methods and safety information:
Nature:
1. molecular formula: C15H19NO3
2. molecular weight: 261.32g/mol
3. Appearance: white crystalline solid
4. Melting point: 83-87°C
5. Solubility: Soluble in organic solvents such as methanol, ethanol, dichloromethane
Use:
benzyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate is a common organic synthesis intermediate, often used in drug synthesis process. It is mainly used for the synthesis of biologically active compounds, such as proline derivatives. It can also be used to synthesize various natural products, polypeptides, antibiotics and other organic compounds.
Preparation Method:
benzyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate are generally synthesized by the following steps:
1. Prolinol formamide is obtained by reacting prolinol with dimethylformamide.
2. Prolinecarboxamide is reacted with benzyl alcohol and an activating agent such as dimethylaminoimidazole (DMAP) is added to produce benzyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate ester.
3. The pure product is obtained by crystallization purification and other methods.
Safety Information:
1. benzyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate is generally safe under normal conditions of use, but it is still necessary to pay attention to reasonable operation and avoid contact with skin and eyes.
2. in the process of operation, should wear appropriate personal protective equipment, such as laboratory gloves, protective glasses, etc.
3. When storing and handling the compound, please follow the correct laboratory procedures and store it in a sealed container, away from fire or oxidizing agents.
Please note that this is a general introduction and reference information only. In the specific use and operation, please be sure to fully understand and confirm before the experiment, and strictly abide by the relevant laboratory safety regulations.
Nature:
1. molecular formula: C15H19NO3
2. molecular weight: 261.32g/mol
3. Appearance: white crystalline solid
4. Melting point: 83-87°C
5. Solubility: Soluble in organic solvents such as methanol, ethanol, dichloromethane
Use:
benzyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate is a common organic synthesis intermediate, often used in drug synthesis process. It is mainly used for the synthesis of biologically active compounds, such as proline derivatives. It can also be used to synthesize various natural products, polypeptides, antibiotics and other organic compounds.
Preparation Method:
benzyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate are generally synthesized by the following steps:
1. Prolinol formamide is obtained by reacting prolinol with dimethylformamide.
2. Prolinecarboxamide is reacted with benzyl alcohol and an activating agent such as dimethylaminoimidazole (DMAP) is added to produce benzyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate ester.
3. The pure product is obtained by crystallization purification and other methods.
Safety Information:
1. benzyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate is generally safe under normal conditions of use, but it is still necessary to pay attention to reasonable operation and avoid contact with skin and eyes.
2. in the process of operation, should wear appropriate personal protective equipment, such as laboratory gloves, protective glasses, etc.
3. When storing and handling the compound, please follow the correct laboratory procedures and store it in a sealed container, away from fire or oxidizing agents.
Please note that this is a general introduction and reference information only. In the specific use and operation, please be sure to fully understand and confirm before the experiment, and strictly abide by the relevant laboratory safety regulations.
Last Update：2024-04-09 15:17:59
