Cyclobutanecarboxylic acid, 3-chloro-

Cyclobutanecarboxylic acid, 3-chloro- - Names and Identifiers

Name	3-chlorocyclobutanecarboxylic acid
Synonyms	LogP 3-CHLOROCYCLOBUTANECARBOXYLIC ACID 3-chlorocyclobutanecarboxylic acid cyclobutanecarboxylic acid, 3-chloro- Cyclobutanecarboxylic acid, 3-chloro- 3-chlorocyclobutane-1-carboxylic acid
CAS	35207-71-7
InChI	InChI=1/C5H7ClO2/c6-4-1-3(2-4)5(7)8/h3-4H,1-2H2,(H,7,8)

Cyclobutanecarboxylic acid, 3-chloro- - Physico-chemical Properties

Molecular Formula	C5H7ClO2
Molar Mass	134.56
Density	1.34
Boling Point	253℃
Flash Point	107℃
Vapor Presure	0.00568mmHg at 25°C
Storage Condition	2-8°C
Refractive Index	1.502

Cyclobutanecarboxylic acid, 3-chloro- - Introduction

The acid is an organic compound whose chemical formula is C4H5ClO2. The following is a description of the nature, use, preparation and safety information of the polymer acid:

Nature:
1. Appearance: acid is a colorless to light yellow solid.
2. Solubility: It can be partially dissolved in water, and more easily dissolved in organic solvents such as ethanol and dimethylformamide (DMF).
3. Saturated vapor pressure: acid has a lower saturated vapor pressure.
4. Melting point and boiling point: Its melting point is about 54-57 degrees Celsius, and its boiling point is about 239-241 degrees Celsius.

Use:
1. Pharmaceutical: acid, as an organic synthesis intermediate, can be used to prepare drugs and biologically active compounds.
2. chemical research: it can be used as an important reaction substrate or catalyst in organic synthesis reaction.

Preparation Method:
acid can be synthesized by the following steps:
1. reacting cyclobutane with thionyl chloride (SO2Cl2) to obtain 3-chlorocyclobutane; br>2.3 chlorocyclobutane is reacted with sodium hydroxide (NaOH) or sodium carbonate (Na2CO3) to obtain acid.

Safety Information:
1. acid may be harmful to human body when contacting skin, eyes or respiratory tract, so wear protective equipment when using it to avoid direct contact.
2. it should be stored in a dry, well-ventilated place, away from fire and oxidant.
3. acid should pay attention to comply with safe operation specifications during use and storage, and handle and dispose of it in accordance with relevant regulations.

Last Update：2024-04-09 20:49:11