Cyclohexanol, 1-(phenylMethyl)-
1-benzylcyclohexan-1-ol
CAS: 1944-01-0
Molecular Formula: C13H18O
Cyclohexanol, 1-(phenylMethyl)- - Names and Identifiers
| Name | 1-benzylcyclohexan-1-ol |
| Synonyms | 1-Benzylcyclohexanol 1-benzylcyclohexan-1-ol 1-(Phenylmethyl)cyclohexanol 1-(phenylmethyl)cyclohexan-1-ol Cyclohexanol, 1-(phenylMethyl)- 1-(phenylmethyl)-1-cyclohexanol |
| CAS | 1944-01-0 |
| EINECS | 217-740-7 |
| InChI | InChI=1/C13H18O/c14-13(9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1,3-4,7-8,14H,2,5-6,9-11H2 |
Cyclohexanol, 1-(phenylMethyl)- - Physico-chemical Properties
| Molecular Formula | C13H18O |
| Molar Mass | 190.28 |
| Density | 1.056g/cm3 |
| Boling Point | 299.9°C at 760 mmHg |
| Flash Point | 118.2°C |
| Vapor Presure | 0.000516mmHg at 25°C |
| Refractive Index | 1.56 |
Cyclohexanol, 1-(phenylMethyl)- - Introduction
1-benzylcyclohexan-1-ol, chemical formula C13H18O, is an organic compound. Its main properties are as follows:
1. Appearance: 1-benzylcyclohexan-1-ol is a colorless to pale yellow liquid.
2. Solubility: It is soluble in many organic solvents, such as ether, chloroform and alcohols.
3. Smell: it has a fragrant smell.
4. Melting point and boiling point: The melting point of 1-benzylcyclohexan-1-ol is 20-23 degrees Celsius, and the boiling point is 238-241 degrees Celsius.
1-benzylcyclohexan-1-ol has a wide range of applications in the chemical and industrial fields, including but not limited to the following uses:
1. Drug: It can be used as an intermediate for synthetic drugs, such as anti-anxiety drugs and anti-cancer drugs.
2. Spices: it can be used to synthesize various perfumes.
3. Coatings and Resins: 1-benzylcyclohexan-1-ol can be used to produce coatings and resins for coatings, plastics and rubber.
4. Functional compounds: It can be used to prepare compounds with specific functions, such as surfactants and functional polymers.
In terms of preparation, 1-benzylcyclohexan-1-ol is usually prepared by benzylation reaction. One common method is to react benzyl chloride with cyclohexanol to form 1-benzylcyclohexan-1-ol.
Regarding safety information, 1-benzylcyclohexan-1-ol should be stored in a closed container, away from fire and oxidizing agents. Avoid inhalation, contact with skin and ingestion. In case of accidental contact, please wash the affected parts in time. Personal protective equipment should be worn during use and handling. In addition, it should be stored, handled and transported in accordance with relevant regulations to ensure safe use.
1. Appearance: 1-benzylcyclohexan-1-ol is a colorless to pale yellow liquid.
2. Solubility: It is soluble in many organic solvents, such as ether, chloroform and alcohols.
3. Smell: it has a fragrant smell.
4. Melting point and boiling point: The melting point of 1-benzylcyclohexan-1-ol is 20-23 degrees Celsius, and the boiling point is 238-241 degrees Celsius.
1-benzylcyclohexan-1-ol has a wide range of applications in the chemical and industrial fields, including but not limited to the following uses:
1. Drug: It can be used as an intermediate for synthetic drugs, such as anti-anxiety drugs and anti-cancer drugs.
2. Spices: it can be used to synthesize various perfumes.
3. Coatings and Resins: 1-benzylcyclohexan-1-ol can be used to produce coatings and resins for coatings, plastics and rubber.
4. Functional compounds: It can be used to prepare compounds with specific functions, such as surfactants and functional polymers.
In terms of preparation, 1-benzylcyclohexan-1-ol is usually prepared by benzylation reaction. One common method is to react benzyl chloride with cyclohexanol to form 1-benzylcyclohexan-1-ol.
Regarding safety information, 1-benzylcyclohexan-1-ol should be stored in a closed container, away from fire and oxidizing agents. Avoid inhalation, contact with skin and ingestion. In case of accidental contact, please wash the affected parts in time. Personal protective equipment should be worn during use and handling. In addition, it should be stored, handled and transported in accordance with relevant regulations to ensure safe use.
Last Update：2024-04-09 21:50:46
