Name | Dipropyl Succinate |
Synonyms | Dipropyl Succinate DIPROPYL SUCCINATE TIMTEC-BB SBB008393 Dipropylbutanedioate dipropyl butanedioate Di-n-propyl succinate DI-N-PROPYL SUCCINATE Succinicaciddi-n-propylester butanedioic acid dipropyl ester Butanedioic acid, dipropyl ester Dipropylester kyseliny jantarove Di-n-propyl succinate, (Succinic acid di-n-propyl ester) |
CAS | 925-15-5 |
EINECS | 213-114-2 |
InChI | InChI=1/C10H18O4/c1-3-7-13-9(11)5-6-10(12)14-8-4-2/h3-8H2,1-2H3 |
Molecular Formula | C10H18O4 |
Molar Mass | 202.25 |
Density | 1 g/cm3 |
Melting Point | -5.9°C |
Boling Point | 250-252°C |
Flash Point | 250-252°C |
Vapor Presure | 0.0212mmHg at 25°C |
Storage Condition | 2-8°C |
Refractive Index | 1.4250 (estimate) |
MDL | MFCD00015213 |
Use | Used as solvent, plastic, perfume intermediate, gas chromatography stationary liquid |
Hazard Symbols | Xn - Harmful |
Risk Codes | 52/53 - Harmful to aquatic organisms, may cause long-term adverse effects in the aquatic environment. |
RTECS | WM7750000 |
NIST chemical information | information provided by: webbook.nist.gov (external link) |
Use | as an intermediate for solvents, plastics, fragrances, gas chromatography stationary liquid |